CAS 28282-25-9
:Elemonic acid
Description:
Elemonic acid, with the CAS number 28282-25-9, is a chemical compound that belongs to the class of fatty acids. It is characterized by its long carbon chain, which typically contains multiple double bonds, contributing to its unsaturated nature. This compound is often derived from natural sources, particularly in the context of plant oils and fats. Elemonic acid is known for its potential applications in various fields, including cosmetics, food industry, and pharmaceuticals, due to its emollient properties and ability to enhance skin hydration. Additionally, it may exhibit antioxidant properties, making it valuable in formulations aimed at protecting against oxidative stress. The molecular structure of elemonic acid includes a carboxylic acid functional group, which is responsible for its acidic characteristics. Overall, elemonic acid is a versatile compound with a range of biological and industrial significance, although specific applications and properties may vary based on its concentration and formulation.
Formula:C30H46O3
InChI:InChI=1S/C30H46O3/c1-19(2)9-8-10-20(26(32)33)21-13-17-30(7)23-11-12-24-27(3,4)25(31)15-16-28(24,5)22(23)14-18-29(21,30)6/h9,20-21,24H,8,10-18H2,1-7H3,(H,32,33)/t20-,21-,24-,28+,29-,30+/m0/s1
InChI key:InChIKey=XLPAINGDLCDYQV-SDTWUMECSA-N
SMILES:C[C@@]12C3=C([C@]4(C)[C@@](CC3)(C(C)(C)C(=O)CC4)[H])CC[C@@]1(C)[C@]([C@H](CCC=C(C)C)C(O)=O)(CC2)[H]
Synonyms:- (13α,14β,17α,20S)-3-Oxolanosta-8,24-dien-21-oic acid
- 13a,14b,17bH-Lanosta-8,24-dien-21-oic acid, 3-oxo-, (20S)- (8CI)
- 13α,14β,17β<span class="text-smallcaps">H</span>-Lanosta-8,24-dien-21-oic acid, 3-oxo-, (20S)-
- 3-Ketotirucalla-8,24-dien-21-oic acid
- 3-Oxo-8,24-tirucalledien-21-oic acid
- 3-Oxotirucalla-8,24-dien-21-oic acid
- 3-Oxotirucallenoic acid
- 3-Oxotirucallic acid
- Elemadienonic acid
- Elemonic acid
- Lanosta-8,24-dien-21-oic acid, 3-oxo-, (13α,14β,17α,20S)-
- b-Elemonic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
β-Elemonic acid
CAS:Beta-Elemonic acid exhibits anti-inflammatory, and anti-cancer effects, it inhibits proliferation by inducing hypoploid cells and cell apoptosis, the anticancer effects of beta-Elemonic acid are related to the MAPK signaling pathway, ROS activation and glutathione depletion in human A549 lung cancer cells. Beta-Elemonic acid exhibits prolyl endopeptidase inhibitory activities.Formula:C30H46O3Purity:95%~99%Molecular weight:454.695β-Elemonic Acid (Standard)
CAS:β-Elemonic Acid (Standard) is a reference standard for research and analysis in studies involving β-Elemonic Acid. β-Elemonic Acid (3-Oxotirucallenoic Acid) exhibits anti-inflammatory effects. Beta-Elemonic acid inhibits proliferation by inducing hypoploid cells and cell apoptosis, the anticancer effects of beta-Elemonic acid are related to the MAPK signaling pathway, ROS activation and glutathione depletion in human A549 lung cancer cells. Beta-Elemonic acid exhibits prolyl endopeptidase inhibitory activities.Formula:C30H46O3Molecular weight:454.68β-Elemonic Acid
CAS:β-Elemonic Acid (3-Oxotirucallenoic Acid) exhibits anti-inflammatory effects, which inhibits proliferation by inducing hypoploid cells and cell apoptosis.Formula:C30H46O3Purity:99.61% - 99.8%Color and Shape:SolidMolecular weight:454.68Ref: TM-T2S0618
1mg35.00€5mg75.00€1mL*10mM (DMSO)84.00€10mg110.00€25mg192.00€50mg286.00€100mg425.00€200mg612.00€β-Elemonic acid
CAS:Carboxylic acid with ketone functionFormula:C30H46O3Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:454.7beta-Elemonic acid
CAS:Controlled ProductBeta-Elemonic acid is a triterpenoid compound, which is a natural product often derived from various plant sources, particularly those belonging to the Burseraceae family. This compound is notable for its complex molecular structure consisting of multiple interconnected carbon rings, a characteristic feature of triterpenes. As a secondary metabolite, beta-Elemonic acid plays a crucial role in plant defense mechanisms, providing resilience against herbivores and microbial attacks.Formula:C30H46O3Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:454.68 g/mol







