CAS 283173-50-2
:Rucaparib
Description:
Rucaparib is a small molecule inhibitor primarily used in cancer therapy, particularly for treating certain types of ovarian and prostate cancers. It functions as a poly(ADP-ribose) polymerase (PARP) inhibitor, which interferes with the DNA repair mechanisms in cancer cells, leading to cell death, especially in those with BRCA mutations. The chemical formula of Rucaparib is C19H20N4O3, and it has a molecular weight of approximately 348.39 g/mol. Rucaparib is typically administered orally and is known for its ability to selectively target cancer cells while sparing normal cells, which contributes to its therapeutic efficacy. Its pharmacokinetics involve absorption, distribution, metabolism, and excretion processes that are crucial for determining dosing regimens. Common side effects may include fatigue, nausea, and anemia, reflecting its impact on rapidly dividing cells. As a targeted therapy, Rucaparib represents a significant advancement in personalized medicine, particularly for patients with specific genetic profiles that predispose them to certain cancers.
Formula:C19H18FN3O
InChI:InChI=1S/C19H18FN3O/c1-21-10-11-2-4-12(5-3-11)18-14-6-7-22-19(24)15-8-13(20)9-16(23-18)17(14)15/h2-5,8-9,21,23H,6-7,10H2,1H3,(H,22,24)
InChI key:InChIKey=HMABYWSNWIZPAG-UHFFFAOYSA-N
SMILES:O=C1C2=C3C(=C(NC3=CC(F)=C2)C4=CC=C(CNC)C=C4)CCN1
Synonyms:- 6H-Azepino[5,4,3-cd]indol-6-one,8-fluoro-1,3,4,5-tetrahydro-2-[4-[(methylamino)methyl]phenyl]-
- 8-Fluoro-1,3,4,5-tetrahydro-2-[4-[(methylamino)methyl]phenyl]-6H-pyrrolo[4,3,2-ef][2]benzazepin-6-one
- 8-Fluoro-2-[4-[(methylamino)methyl]phenyl]-1,3,4,5-tetrahydro-6H-azepino[5,4,3-cd]indol-6-one
- Rubraca
- Rucaparib
- 6H-Pyrrolo[4,3,2-ef][2]benzazepin-6-one, 8-fluoro-1,3,4,5-tetrahydro-2-[4-[(methylamino)methyl]phenyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
6H-Pyrrolo[4,3,2-ef][2]benzazepin-6-one,8-fluoro-1,3,4,5-tetrahydro-2-[4-[(methylamino)methyl]phenyl]-
CAS:Formula:C19H18FN3OPurity:98%Color and Shape:SolidMolecular weight:323.3641Rucaparib
CAS:Formula:C19H18FN3OPurity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:323.37Rucaparib
CAS:Rucaparib (PF-01367338) is a orally PARP inhibitor and a H6PD inhibitor. Rucaparib exhibits antitumor activity against CRPC. Cost-effective and quality-assured.Formula:C19H18FN3OPurity:98.24% - 99.80%Color and Shape:SolidMolecular weight:323.36Ref: TM-T4463
2mg48.00€5mg73.00€10mg115.00€25mg173.00€50mg235.00€100mg364.00€200mg540.00€500mg869.00€1mL*10mM (DMSO)81.00€Rucaparib
CAS:Controlled Product<p>Applications Rucaparib is PARP1 inhibitor. It can be used in biological study of chemical screening to identify drugs that enhance or mitigate cellular responses to antibody-toxin fusion proteins using human B cell precursor leukemia cells and cervical adenocarcinoma cells.<br>References Antignani, A., et al.: PLoS One, 11, e0161415/1-e0161415/17 (2016)<br></p>Formula:C19H18FN3OColor and Shape:NeatMolecular weight:323.36Rucaparib
CAS:<p>Inhibitor of poly (ADP-ribose) polymerase enzyme; antineoplastic</p>Formula:C19H18FN3OPurity:Min. 98 Area-%Color and Shape:Yellow PowderMolecular weight:323.36 g/mol







