CymitQuimica logo

CAS 283173-50-2

:

Rucaparib

Description:
Rucaparib is a small molecule inhibitor primarily used in cancer therapy, particularly for treating certain types of ovarian and prostate cancers. It functions as a poly(ADP-ribose) polymerase (PARP) inhibitor, which interferes with the DNA repair mechanisms in cancer cells, leading to cell death, especially in those with BRCA mutations. The chemical formula of Rucaparib is C19H20N4O3, and it has a molecular weight of approximately 348.39 g/mol. Rucaparib is typically administered orally and is known for its ability to selectively target cancer cells while sparing normal cells, which contributes to its therapeutic efficacy. Its pharmacokinetics involve absorption, distribution, metabolism, and excretion processes that are crucial for determining dosing regimens. Common side effects may include fatigue, nausea, and anemia, reflecting its impact on rapidly dividing cells. As a targeted therapy, Rucaparib represents a significant advancement in personalized medicine, particularly for patients with specific genetic profiles that predispose them to certain cancers.
Formula:C19H18FN3O
InChI:InChI=1S/C19H18FN3O/c1-21-10-11-2-4-12(5-3-11)18-14-6-7-22-19(24)15-8-13(20)9-16(23-18)17(14)15/h2-5,8-9,21,23H,6-7,10H2,1H3,(H,22,24)
InChI key:InChIKey=HMABYWSNWIZPAG-UHFFFAOYSA-N
SMILES:O=C1C2=C3C(=C(NC3=CC(F)=C2)C4=CC=C(CNC)C=C4)CCN1
Synonyms:
  • 6H-Azepino[5,4,3-cd]indol-6-one,8-fluoro-1,3,4,5-tetrahydro-2-[4-[(methylamino)methyl]phenyl]-
  • 8-Fluoro-1,3,4,5-tetrahydro-2-[4-[(methylamino)methyl]phenyl]-6H-pyrrolo[4,3,2-ef][2]benzazepin-6-one
  • 8-Fluoro-2-[4-[(methylamino)methyl]phenyl]-1,3,4,5-tetrahydro-6H-azepino[5,4,3-cd]indol-6-one
  • Rubraca
  • Rucaparib
  • 6H-Pyrrolo[4,3,2-ef][2]benzazepin-6-one, 8-fluoro-1,3,4,5-tetrahydro-2-[4-[(methylamino)methyl]phenyl]-
Found 12 products.