CAS 2834-05-1
:11-Bromoundecanoic acid
Description:
11-Bromoundecanoic acid is a fatty acid derivative characterized by the presence of a bromine atom at the 11th carbon position of the undecanoic acid chain. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while exhibiting limited solubility in water due to its long hydrophobic carbon chain. The presence of the bromine atom introduces unique reactivity, making it useful in various chemical syntheses and applications, including as a reagent in organic chemistry and in the development of surfactants. Its molecular structure contributes to its properties, such as melting point and boiling point, which are influenced by the length of the carbon chain and the presence of the bromine substituent. Additionally, 11-bromoundecanoic acid can participate in reactions typical of carboxylic acids, such as esterification and acylation, making it a valuable intermediate in the synthesis of more complex molecules. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns.
Formula:C11H21BrO2
InChI:InChI=1S/C11H21BrO2/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h1-10H2,(H,13,14)
InChI key:InChIKey=IUDGNRWYNOEIKF-UHFFFAOYSA-N
SMILES:C(CCCCCCCBr)CCC(O)=O
Synonyms:- 11-Bromo-1-Undecanoic Acid
- 11-Bromo-Undecanoicaci
- 11-Bromodecanoic Acid
- 11-Bromohendecanoic Acid
- 11-Bromoundecanoate
- 11-BromoundecanoicAcid
- Bromoundecanoicacid
- NSC 14781
- Undecanoic acid, 11-bromo-
- ω-Bromoundecanoic acid
- 11-Bromoundecanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
11-Bromoundecanoic Acid
CAS:Formula:C11H21BrO2Purity:>97.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:265.1911-Bromoundecanoic acid
CAS:Formula:C11H21BrO2Purity:98%Color and Shape:SolidMolecular weight:265.187211-Bromoundecanoic Acid
CAS:11-Bromoundecanoic AcidFormula:C11H21BrO2Purity:98%Molecular weight:265.1911-Bromoundecanoic acid
CAS:11-Bromoundecanoic acid is a heterobifunctional reagent that is used in the synthesis of phospholipids. This chemical reacts with an amide group on a phosphatidylcholine to introduce a bromine atom, which can be used as a fluorophore. The reaction is done in an organic solvent, such as dichloromethane, which facilitates the reaction by dissolving the reactants. The reaction can be monitored using fluorescence assay techniques and 11-bromoundecanoic acid is characterized by its constant ring-opening constant and fatty acid chain length.Formula:C11H21BrO2Purity:Min. 95%Color and Shape:PowderMolecular weight:265.19 g/mol11-Bromoundecanoic acid
CAS:Formula:C11H21BrO2Purity:95%Color and Shape:Solid, Chips or Crystalline Powder or Flakes or PowderMolecular weight:265.19111-Bromoundecanoic Acid
CAS:Controlled ProductFormula:C11H21BrO2Color and Shape:NeatMolecular weight:265.19






