CymitQuimica logo

CAS 28443-69-8

:

4-amino-2,3,5-trichloropyridine

Description:
4-Amino-2,3,5-trichloropyridine is an organic compound characterized by its pyridine ring substituted with three chlorine atoms and an amino group. The presence of these functional groups significantly influences its chemical properties and reactivity. This compound typically appears as a solid at room temperature and is known for its potential applications in agrochemicals, particularly as a herbicide or pesticide due to its biological activity. The chlorine substituents enhance its lipophilicity and stability, while the amino group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. In terms of safety, like many chlorinated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Its synthesis often involves chlorination reactions of pyridine derivatives, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. Overall, 4-amino-2,3,5-trichloropyridine is a compound of interest in both industrial and research settings due to its unique chemical characteristics.
Formula:C5H3Cl3N2
InChI:InChI=1/C5H3Cl3N2/c6-2-1-10-5(8)3(7)4(2)9/h1H,(H2,9,10)
InChI key:YYJDUYUWQJWYNA-UHFFFAOYSA-N
SMILES:c1c(c(c(c(Cl)n1)Cl)N)Cl
Synonyms:
  • 2,3,5-Trichloropyridin-4-Amine
  • 2,3,5-Trichloro-4-Aminopyridine
Found 6 products.