CAS 284461-82-1
:2-Pyridinecarboxamide,4-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-N-ethyl-
Description:
2-Pyridinecarboxamide, 4-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-N-ethyl- is a complex organic compound characterized by its multi-functional structure, which includes a pyridine ring, amide groups, and a trifluoromethyl-substituted phenyl moiety. The presence of the chloro and trifluoromethyl groups suggests potential applications in pharmaceuticals, particularly in the development of targeted therapies due to their influence on biological activity and lipophilicity. This compound may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Its molecular structure indicates potential interactions with biological targets, making it of interest in medicinal chemistry. The CAS number 284461-82-1 uniquely identifies this compound, facilitating its recognition in scientific literature and databases. Overall, the characteristics of this substance highlight its potential utility in research and development within the fields of chemistry and pharmacology.
Formula:C22H18ClF3N4O3
InChI:InChI=1S/C22H18ClF3N4O3/c1-2-27-20(31)19-12-16(9-10-28-19)33-15-6-3-13(4-7-15)29-21(32)30-14-5-8-18(23)17(11-14)22(24,25)26/h3-12H,2H2,1H3,(H,27,31)(H2,29,30,32)
InChI key:YENKTYRMOJFDJW-UHFFFAOYSA-N
SMILES:CCNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F
Synonyms:- [Synonyms]
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery

