CAS 284474-50-6

4'-chloroacetophenone-2',3',5',6'-D4

Description:

4'-Chloroacetophenone-2',3',5',6'-D4 is a deuterated derivative of 4-chloroacetophenone, which is an aromatic ketone. This compound features a chloro group at the para position relative to the acetophenone moiety, and the presence of deuterium atoms (D) at the 2', 3', 5', and 6' positions of the phenyl ring indicates that it is isotopically labeled, which is often used in research to trace chemical pathways or enhance NMR spectroscopy signals. The deuteration can affect the physical and chemical properties, such as solubility and reactivity, compared to its non-deuterated counterpart. 4'-Chloroacetophenone itself is known for its applications in organic synthesis and as a reagent in various chemical reactions. The specific isotopic labeling can also be beneficial in studies involving kinetics and mechanisms of reactions. As with many organic compounds, safety precautions should be observed when handling this substance due to its potential irritant properties.

Formula: C8H7ClO

InChI: InChI=1S/C8H7ClO/c1-6(10)7-2-4-8(9)5-3-7/h2-5H,1H3/i2D,3D,4D,5D

InChI key: BUZYGTVTZYSBCU-QFFDRWTDSA-N

SMILES: [2H]C1=C(C(=C(C(=C1C(=O)C)[2H])[2H])Cl)[2H]

4'-Chloroacetophenone-2',3',5',6'-d4

CAS: 284474-50-6, 99-91-2

Formula: ClC₆D₄COCH₃

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 158.04365

Ref: 3U-D5379

4'-Chloroacetophenone-2',3',5',6'-d4

Controlled Product

CAS: 284474-50-6

Applications 4'-Chloroacetophenone-2',3',5',6'-d4 (CAS# 284474-50-6) is a useful isotopically labeled research compound.

Formula: C₈D₄H₃ClO

Color and Shape: Neat

Molecular weight: 158.6182

Ref: TR-C363386