CAS 28494-51-1
:1-Methyl-4-nitro-1H-pyrrole-2-carbonyl chloride
Description:
1-Methyl-4-nitro-1H-pyrrole-2-carbonyl chloride is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a methyl group at the 1-position and a nitro group at the 4-position contributes to its unique reactivity and properties. The carbonyl chloride functional group indicates that it is an acyl chloride, making it reactive towards nucleophiles, which is useful in various synthetic applications. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules. It may exhibit moderate to high toxicity, and appropriate safety measures should be taken when handling it, including the use of personal protective equipment and working in a well-ventilated area or fume hood. Additionally, it is important to consider its environmental impact and regulatory status when using or disposing of this substance. Overall, 1-Methyl-4-nitro-1H-pyrrole-2-carbonyl chloride is a valuable intermediate in chemical synthesis, particularly in the pharmaceutical and agrochemical industries.
Formula:C6H5ClN2O3
InChI:InChI=1S/C6H5ClN2O3/c1-8-3-4(9(11)12)2-5(8)6(7)10/h2-3H,1H3
InChI key:InChIKey=ZBXBOVMIODZOBQ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C(Cl)=O)N(C)C1
Synonyms:- 1-Methyl-4-nitropyrrole-2-carbonyl chloride
- 1-Methyl-4-nitro-2-pyrrolecarboxylic acid chloride
- 1H-Pyrrole-2-carbonyl chloride, 1-methyl-4-nitro-
- Pyrrole-2-carbonyl chloride, 1-methyl-4-nitro-
- 1-Methyl-4-nitro-1H-pyrrole-2-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
