CymitQuimica logo

CAS 285-63-2

:

6-Azabicyclo[3.1.0]hexane

Description:
6-Azabicyclo[3.1.0]hexane, with the CAS number 285-63-2, is a bicyclic organic compound characterized by its unique structure that includes a nitrogen atom incorporated into a six-membered ring. This compound features a bicyclic framework consisting of three carbon atoms and one nitrogen atom, creating a distinctive azabicyclic system. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the nitrogen atom contributes to its basicity and potential reactivity, making it of interest in various chemical syntheses and applications. 6-Azabicyclo[3.1.0]hexane can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to its strained ring structure. Its derivatives may exhibit biological activity, making it relevant in medicinal chemistry. Additionally, the compound's physical properties, such as boiling point and solubility, can vary based on the specific conditions and substituents present. Overall, 6-Azabicyclo[3.1.0]hexane is a significant compound in organic chemistry with potential applications in pharmaceuticals and materials science.
Formula:C5H9N
InChI:InChI=1S/C5H9N/c1-2-4-5(3-1)6-4/h4-6H,1-3H2
InChI key:YZXVYUZDVBWITQ-UHFFFAOYSA-N
SMILES:C1CC2C(C1)N2
Synonyms:
  • Cyclopentenimine
Found 4 products.