CAS 28541-75-5: (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-methoxyphenoxy)tetrahydropyran-3,4,5-triol
Description:The chemical substance known as "(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-methoxyphenoxy)tetrahydropyran-3,4,5-triol," with the CAS number 28541-75-5, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple hydroxyl groups, indicating it is a polyol, which contributes to its hydrophilicity and potential solubility in water. The presence of a methoxyphenoxy group enhances its structural diversity and may influence its biological activity. The specific stereochemistry, denoted by the R and S configurations, suggests that the compound has distinct spatial arrangements that can affect its reactivity and interactions with biological systems. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry and drug development. Additionally, the hydroxymethyl and methoxy groups can participate in various chemical reactions, further expanding the potential applications of this substance in synthetic organic chemistry.
Formula:C13H18O7
InChI:InChI=1/C13H18O7/c1-18-7-2-4-8(5-3-7)19-13-12(17)11(16)10(15)9(6-14)20-13/h2-5,9-17H,6H2,1H3/t9-,10-,11+,12+,13+/m1/s1
- Synonyms:
- 4-Methoxyphenyl α-D-Mannopyranoside
- α-D-mannopyranoside, 4-methoxyphenyl
