CAS 28541-75-5
:(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-methoxyphenoxy)tetrahydropyran-3,4,5-triol
Description:
The chemical substance known as "(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-methoxyphenoxy)tetrahydropyran-3,4,5-triol," with the CAS number 28541-75-5, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple hydroxyl groups, indicating it is a polyol, which contributes to its hydrophilicity and potential solubility in water. The presence of a methoxyphenoxy group enhances its structural diversity and may influence its biological activity. The specific stereochemistry, denoted by the R and S configurations, suggests that the compound has distinct spatial arrangements that can affect its reactivity and interactions with biological systems. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry and drug development. Additionally, the hydroxymethyl and methoxy groups can participate in various chemical reactions, further expanding the potential applications of this substance in synthetic organic chemistry.
Formula:C13H18O7
InChI:InChI=1/C13H18O7/c1-18-7-2-4-8(5-3-7)19-13-12(17)11(16)10(15)9(6-14)20-13/h2-5,9-17H,6H2,1H3/t9-,10-,11+,12+,13+/m1/s1
Synonyms:- 4-Methoxyphenyl α-D-Mannopyranoside
- α-D-mannopyranoside, 4-methoxyphenyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Methoxyphenyl α-D-Mannopyranoside
CAS:Formula:C13H18O7Purity:>98.0%(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:286.284-Methoxyphenyl α-d-mannopyranoside
CAS:Formula:C13H18O7Purity:98%Color and Shape:SolidMolecular weight:286.2778(2R,3S,4S,5S,6R)-2-(Hydroxymethyl)-6-(4-Methoxyphenoxy)Tetrahydro-2H-Pyran-3,4,5-Triol
CAS:(2R,3S,4S,5S,6R)-2-(Hydroxymethyl)-6-(4-Methoxyphenoxy)Tetrahydro-2H-Pyran-3,4,5-TriolFormula:C13H18O7Purity:98%Molecular weight:286.284-Methoxyphenyl a-D-mannopyranoside
CAS:4-Methoxyphenyl a-D-mannopyranoside is a fluorinated monosaccharide. It is synthesized by the reaction of 4-methoxyphenol with an aldose in the presence of sodium hydroxide and sulfuric acid. The product is purified by chromatography with silica gel and eluted with methanol. This compound is also used to produce polysaccharides, glycosyls, oligosaccharides, or complex carbohydrates through glycosylation or polysaccaride synthesis. 4-Methoxyphenyl a-D-mannopyranoside can be modified to produce methylated, acetalized, or deoxygenated derivatives for use in click chemistry reactions.Formula:C13H18O7Purity:Min. 95%Color and Shape:White PowderMolecular weight:286.28 g/mol(2R,3S,4S,5S,6R)-2-(Hydroxymethyl)-6-(4-methoxyphenoxy)tetrahydro-2H-pyran-3,4,5-triol
CAS:Purity:98%(HPLC);RGMolecular weight:286.2799988





