CymitQuimica logo

CAS 28562-68-7

:

3-methyloxetane-3-carboxylic acid

Description:
3-Methyloxetane-3-carboxylic acid is a cyclic compound characterized by a five-membered oxetane ring with a carboxylic acid functional group and a methyl substituent. The presence of the oxetane ring imparts unique strain and reactivity to the molecule, making it an interesting subject for synthetic organic chemistry. The carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, which can influence its solubility and reactivity in various chemical environments. This compound may exhibit moderate polarity due to the combination of the polar carboxylic acid and the non-polar oxetane ring. Its structural features suggest potential applications in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Additionally, the presence of the methyl group can affect the steric hindrance and reactivity of the compound, making it a valuable intermediate in organic synthesis. Overall, 3-methyloxetane-3-carboxylic acid is a versatile compound with unique properties that can be exploited in various chemical applications.
Formula:C5H8O3
InChI:InChI=1/C5H8O3/c1-5(4(6)7)2-8-3-5/h2-3H2,1H3,(H,6,7)
InChI key:PMPZEEUNGQSAIQ-UHFFFAOYSA-N
SMILES:CC1(COC1)C(=O)O
Synonyms:
  • 3-Oxetanecarboxylic acid, 3-methyl-
Found 5 products.