CymitQuimica logo

CAS 28599-52-2

:

5-bromo-2,4-dimethyl-1,3-thiazole

Description:
5-Bromo-2,4-dimethyl-1,3-thiazole is a heterocyclic organic compound characterized by its thiazole ring, which contains both sulfur and nitrogen atoms. The presence of bromine and two methyl groups at specific positions on the ring contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. It is known for its potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis due to its reactivity and ability to participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions. The thiazole ring structure imparts biological activity, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the substituents on the ring, which can affect its interaction with biological targets. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C5H6BrNS
InChI:InChI=1/C5H6BrNS/c1-3-5(6)8-4(2)7-3/h1-2H3
InChI key:BSFCVAYFJQLZEU-UHFFFAOYSA-N
SMILES:Cc1c(Br)sc(C)n1
Found 4 products.