CAS 2867633-84-7
:FAAH-IN-8
Description:
FAAH-IN-8, with the CAS number 2867633-84-7, is a selective inhibitor of the enzyme fatty acid amide hydrolase (FAAH). This enzyme is responsible for the breakdown of endocannabinoids, which are lipid-based neurotransmitters that play a crucial role in various physiological processes, including pain sensation, mood regulation, and appetite control. By inhibiting FAAH, FAAH-IN-8 can increase the levels of endocannabinoids, potentially enhancing their therapeutic effects. The compound is characterized by its ability to modulate the endocannabinoid system, making it a subject of interest in research related to pain management, anxiety, and other neurological disorders. Additionally, FAAH-IN-8 is typically studied in the context of drug development for conditions where endocannabinoid signaling is disrupted. Its chemical structure and properties contribute to its specificity and efficacy as a FAAH inhibitor, although detailed physicochemical properties such as solubility, stability, and bioavailability would require further investigation in a laboratory setting.
Formula:C18H14N4O
InChI:InChI=1S/C18H14N4O/c1-2-11-22-15-10-6-3-7-12(15)16(17(22)23)21-18-19-13-8-4-5-9-14(13)20-18/h2-10,23H,1,11H2
InChI key:HPYRWHMUXLAOBS-UHFFFAOYSA-N
SMILES:C=CCN1C2=CC=CC=C2C(=C1O)N=C3N=C4C=CC=CC4=N3
Synonyms:- FAAH-IN-8
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
FAAH-IN-8
CAS:FAAH-IN-8 (compound 11) is a competitive inhibitor of FAAH with an IC50 of 6.7 nM and a Ki of 5 nM. It exhibits high blood-brain permeability and a significant antioxidant profile without neurotoxicity [1].Formula:C18H14N4OColor and Shape:SolidMolecular weight:302.33
