CymitQuimica logo

CAS 28686-90-0

:

methyl 4-methylthiophene-2-carboxylate

Description:
Methyl 4-methylthiophene-2-carboxylate is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features a methyl group and a carboxylate ester functional group, contributing to its reactivity and solubility properties. It is typically a colorless to pale yellow liquid with a distinctive odor, indicative of its aromatic nature. The presence of the methylthio group enhances its chemical reactivity, making it useful in various synthetic applications, particularly in the field of organic synthesis and pharmaceuticals. Methyl 4-methylthiophene-2-carboxylate is soluble in organic solvents such as ethanol and ether, but has limited solubility in water due to its hydrophobic thiophene structure. Its chemical behavior can be influenced by the presence of the ester group, which can undergo hydrolysis or transesterification under appropriate conditions. Overall, this compound is of interest for its potential applications in the synthesis of more complex organic molecules and its role in various chemical reactions.
Formula:C7H8O2S
InChI:InChI=1/C7H8O2S/c1-5-3-6(10-4-5)7(8)9-2/h3-4H,1-2H3
InChI key:YUJMWNYIBNSQPL-UHFFFAOYSA-N
SMILES:Cc1cc(C(=O)OC)sc1
Synonyms:
  • 2-Thiophenecarboxylic acid, 4-methyl-, methyl ester
  • Methyl 4-methylthiophene-2-carboxylate
Found 4 products.