CymitQuimica logo

CAS 286947-68-0

:

1-Iodo-4-(pentafluoro-lambda~6~-sulfanyl)benzene

Description:
1-Iodo-4-(pentafluoro-lambda^6-sulfanyl)benzene is an organofluorine compound characterized by the presence of both iodine and a pentafluorosulfanyl group attached to a benzene ring. The iodine atom is a halogen, which typically imparts reactivity and can facilitate nucleophilic substitution reactions. The pentafluorosulfanyl group (SF5) is a highly electronegative moiety, contributing to the compound's unique electronic properties and enhancing its potential applications in materials science and medicinal chemistry. This compound is likely to exhibit significant thermal stability and may be hydrophobic due to the presence of multiple fluorine atoms. Its synthesis and reactivity can be influenced by the steric and electronic effects of the substituents on the aromatic ring. Additionally, the presence of the SF5 group can enhance the lipophilicity of the compound, making it of interest in drug design and development. Overall, 1-Iodo-4-(pentafluoro-lambda^6-sulfanyl)benzene represents a class of compounds that combine halogen and fluorinated functionalities, leading to diverse chemical behavior and potential applications.
Formula:C6H4F5IS
InChI:InChI=1/C6H4F5IS/c7-13(8,9,10,11)6-3-1-5(12)2-4-6/h1-4H
InChI key:FRYANWYSCROOCU-UHFFFAOYSA-N
SMILES:c1cc(ccc1I)S(F)(F)(F)(F)F
Synonyms:
  • Sulfur, Pentafluoro(4-Iodophenyl)-
  • 4-Iodophenylsulfur pentafluoride
Found 5 products.