CAS 287100-82-7

Formula: C18H34O2

InChI: InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9-/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1,13+1,14+1,15+1,16+1,17+1,18+1

InChI key: ZQPPMHVWECSIRJ-IGBBIXMTSA-N

SMILES: [13CH3][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2]/[13CH]=[13CH]\[13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13C](=O)O

Oleic Acid-13C18

CAS: 287100-82-7

Oleic Acid-13C18

Formula: CH₃₄O₂

Purity: ≥98 atom% 13C,≥95%

Molecular weight: 300.33

Ref: 54-OR1143900

Oleic acid-13C18

CAS: 287100-82-7

Oleic acid-13C18 is a 13C-labelled form of oleic acid (T2O2668) suitable for isotope tracing experiments. Oleic acid (9-cis-octadecenoic acid) is the most common monounsaturated fatty acid found in human fat cells and other tissues, and acts as an activator of the Na+/K+-ATPase.

Formula: C₁₈H₃₄O₂

Purity: 99.73%

Molecular weight: 300.33

Ref: TM-TMID-1008

Oleic acid-UL-13C18

CAS: 287100-82-7

Formula: C18H34O2

Purity: >95%

Color and Shape: Liquid

Molecular weight: 300.33

Ref: 48-78-1851

Oleic Acid-13C18

CAS: 287100-82-7

Purity: 95%

Ref: IN-DA00C1R9

Oleic Acid-[13C18]

CAS: 287100-82-7

Formula: C₁₈H₃₄O₂

Molecular weight: 300.33

Ref: BE-MC-6111C18

Oleic acid-ul-13C18

CAS: 287100-82-7

Oleic acid-ul-13C18 is a stable isotopically labeled compound, specifically a carbon-13 enriched fatty acid, which is derived from natural oleic acid through isotopic enrichment processes. Its primary mode of action involves serving as a tracer in metabolic studies, where it allows for the investigation of lipid metabolism by tracking the incorporation and transformation of fatty acids in biological systems.

Formula: C₁₈H₃₄O₂

Purity: Min. 95%

Molecular weight: 300.33 g/mol

Ref: 3D-MLA10082