CymitQuimica logo

CAS 2875-94-7

:

propane-D8

Description:
Propane-D8, also known as 1,1,2,2,3,3,4,4-octadeuteropropane, is a deuterated form of propane, where all hydrogen atoms are replaced by deuterium, a heavier isotope of hydrogen. Its chemical formula is C3D8, and it is primarily used in research and analytical applications, particularly in nuclear magnetic resonance (NMR) spectroscopy, due to its unique isotopic labeling. Propane-D8 is a colorless, odorless gas at room temperature and pressure, similar to its non-deuterated counterpart, propane. It exhibits similar physical properties, such as boiling and melting points, but with slight variations due to the increased mass of deuterium. The presence of deuterium can influence reaction kinetics and mechanisms, making it valuable in studies of reaction pathways. Additionally, propane-D8 is non-toxic and non-flammable under standard conditions, although safety precautions should still be observed when handling any gas. Its unique characteristics make it an important tool in various fields, including organic chemistry, biochemistry, and materials science.
Formula:C3D8
InChI:InChI=1/C3H8/c1-3-2/h3H2,1-2H3/i1D3,2D3,3D2
InChI key:ATUOYWHBWRKTHZ-AUOAYUKBSA-N
SMILES:C(C(C([2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]
Synonyms:
  • (~2~H_8_)propane
Found 1 products.