CAS 287930-73-8
:4-Benzyl-2-hydroxy-morpholin-3-one
Description:
4-Benzyl-2-hydroxy-morpholin-3-one, identified by its CAS number 287930-73-8, is a chemical compound that belongs to the morpholine class of compounds. It features a morpholinone core structure, which is characterized by a six-membered ring containing both oxygen and nitrogen atoms. The presence of a benzyl group at the 4-position and a hydroxyl group at the 2-position contributes to its unique chemical properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmaceutical research. Its solubility, stability, and reactivity can be influenced by the functional groups attached to the morpholine ring. Additionally, the compound's potential applications could include roles as intermediates in organic synthesis or as active pharmaceutical ingredients. As with many morpholine derivatives, it is essential to consider safety and handling protocols due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C11H13NO3
InChI:InChI=1/C11H13NO3/c13-10-11(14)15-7-6-12(10)8-9-4-2-1-3-5-9/h1-5,11,14H,6-8H2
SMILES:c1ccc(cc1)CN1CCOC(C1=O)O
Synonyms:- 3-Morpholinone, 2-Hydroxy-4-(Phenylmethyl)-
- 4-Benzyl-2-hydroxymorpholin-3-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Benzyl-2-hydroxymorpholin-3-one
CAS:Formula:C11H13NO3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:207.233-Morpholinone, 2-hydroxy-4-(phenylmethyl)-
CAS:Formula:C11H13NO3Purity:97%Color and Shape:SolidMolecular weight:207.22584-Benzyl-2-Hydroxy-Morpholin-3-One
CAS:4-Benzyl-2-Hydroxy-Morpholin-3-OneFormula:C11H13NO3Purity:98%Molecular weight:207.232-Hydroxy-4-(phenylmethyl)-3-morpholinone
CAS:Controlled ProductApplications 2-Hydroxy-4-(phenylmethyl)-3-morpholinone, is an intermediate used for the synthesis of NK1 Receptor Antagonist Aprepitant (A729800), used as as antiemetic drugs.
References Brands, K. M., et al.: J. Americ. Chem. Soci., 15 (8), 2129 (2003);Formula:C11H13NO3Color and Shape:NeatMolecular weight:207.234-Benzyl-2-hydroxymorpholin-3-one
CAS:4-Benzyl-2-hydroxymorpholin-3-one is a reagent that is used to synthesize glyoxylic acid with the help of methanol and ethanolamine. This product can be used as a reagent, catalytic, or reactant in industrial processes. It's also a conditioner for trifluoroacetic acid and an aprepitant. 4-Benzyl-2-hydroxymorpholin-3-one can be purified by recrystallization.Formula:C11H13NO3Purity:Min. 95%Molecular weight:207.23 g/mol






