CAS 28808-62-0
:Fraxinellone
Description:
Fraxinellone is a naturally occurring chemical compound classified as a coumarin derivative. It is primarily extracted from the bark of the Fraxinus species, particularly the ash tree. This compound is characterized by its unique bicyclic structure, which contributes to its biological activity. Fraxinellone exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial effects, making it of interest in medicinal chemistry and natural product research. Its molecular formula typically includes carbon, hydrogen, and oxygen atoms, reflecting its organic nature. The compound is often studied for its potential therapeutic applications, particularly in traditional medicine systems. Additionally, fraxinellone's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its extraction and application in formulations. Overall, fraxinellone represents a significant compound in the field of natural products, with ongoing research aimed at elucidating its mechanisms of action and potential health benefits.
Formula:C14H16O3
InChI:InChI=1S/C14H16O3/c1-9-4-3-6-14(2)11(9)13(15)17-12(14)10-5-7-16-8-10/h5,7-8,12H,3-4,6H2,1-2H3/t12-,14+/m0/s1
InChI key:InChIKey=XYYAFLHHHZVPRN-GXTWGEPZSA-N
SMILES:C[C@]12[C@@H](OC(=O)C1=C(C)CCC2)C=3C=COC3
Synonyms:- (3R,3aR)-3-(3-Furanyl)-3a,4,5,6-tetrahydro-3a,7-dimethyl-1(3H)-isobenzofuranone
- (3R,3aR)-3-(3-Furyl)-3a,7-dimethyl-3a,4,5,6-tetrahydro-2-benzofuran-1(3H)-one
- (3R,3aR)-3-(furan-3-yl)-3a,7-dimethyl-3a,4,5,6-tetrahydro-2-benzofuran-1(3H)-one
- 1(3H)-Isobenzofuranone, 3-(3-furanyl)-3a,4,5,6-tetrahydro-3a,7-dimethyl-, (3R-cis)-
- 1(3H)-isobenzofuranone, 3-(3-furanyl)-3a,4,5,6-tetrahydro-3a,7-dimethyl-, (3R,3aR)-
- Phthalide, 3-(3-furyl)-3a,4,5,6-tetrahydro-3a,7-dimethyl-
- Fraxinellone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Fraxinellone
CAS:Formula:C14H16O3Purity:>96.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:232.281(3H)-Isobenzofuranone, 3-(3-furanyl)-3a,4,5,6-tetrahydro-3a,7-dimethyl-, (3R,3aR)-
CAS:Formula:C14H16O3Purity:95%Color and Shape:SolidMolecular weight:232.2750(3R,3aR)-3-(Furan-3-Yl)-3A,7-Dimethyl-3A,4,5,6-Tetrahydroisobenzofuran-1(3H)-One
CAS:(3R,3aR)-3-(Furan-3-Yl)-3A,7-Dimethyl-3A,4,5,6-Tetrahydroisobenzofuran-1(3H)-OnePurity:99%Molecular weight:232.28g/molFraxinellone
CAS:<p>1.</p>Formula:C14H16O3Purity:99.35% - 99.92%Color and Shape:SolidMolecular weight:232.27Fraxinellone
CAS:LactoneFormula:C14H16O3Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:232.28Fraxinellone
CAS:Controlled Product<p>Applications Fraxinellone is an insecticidal agent, inhibiting growth of larvae, used in the treatment and protection of crops and produce. Also, a naturally occurring compound used in the treatment of tumors.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Lu, M. et al.: Mol. 18, 2754 (2013); Guo, Y. et al.: J. Agri. Food. Chem., 61, 11937 (2013);<br></p>Formula:C14H16O3Color and Shape:NeatMolecular weight:232.28Fraxinellone
CAS:<p>Fraxinellone is a naturally occurring sesquiterpenoid lactone, which is derived from the plant species Dictamnus dasycarpus, commonly known as the burning bush. It exhibits its mode of action through the disruption of calcium ion channels, leading to neurotoxic effects in target organisms. This interaction with calcium channel pathways is crucial for its bioactivity, influencing both insecticidal and potential therapeutic effects.</p>Purity:Min. 95%
