CAS 28808-62-0: Fraxinellone
Description:Fraxinellone is a naturally occurring chemical compound classified as a coumarin derivative. It is primarily extracted from the bark of the Fraxinus species, particularly the ash tree. This compound is characterized by its unique bicyclic structure, which contributes to its biological activity. Fraxinellone exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial effects, making it of interest in medicinal chemistry and natural product research. Its molecular formula typically includes carbon, hydrogen, and oxygen atoms, reflecting its organic nature. The compound is often studied for its potential therapeutic applications, particularly in traditional medicine systems. Additionally, fraxinellone's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its extraction and application in formulations. Overall, fraxinellone represents a significant compound in the field of natural products, with ongoing research aimed at elucidating its mechanisms of action and potential health benefits.
Formula:C14H16O3
InChI:InChI=1S/C14H16O3/c1-9-4-3-6-14(2)11(9)13(15)17-12(14)10-5-7-16-8-10/h5,7-8,12H,3-4,6H2,1-2H3/t12-,14+/m0/s1
InChI key:InChIKey=XYYAFLHHHZVPRN-GXTWGEPZSA-N
SMILES:O=C1OC(C2=COC=C2)C3(C1=C(C)CCC3)C
- Synonyms:
- (3R,3aR)-3-(3-Furanyl)-3a,4,5,6-tetrahydro-3a,7-dimethyl-1(3H)-isobenzofuranone
- (3R,3aR)-3-(3-Furyl)-3a,7-dimethyl-3a,4,5,6-tetrahydro-2-benzofuran-1(3H)-one
- (3R,3aR)-3-(furan-3-yl)-3a,7-dimethyl-3a,4,5,6-tetrahydro-2-benzofuran-1(3H)-one
- 1(3H)-Isobenzofuranone, 3-(3-furanyl)-3a,4,5,6-tetrahydro-3a,7-dimethyl-, (3R-cis)-
- 1(3H)-isobenzofuranone, 3-(3-furanyl)-3a,4,5,6-tetrahydro-3a,7-dimethyl-, (3R,3aR)-
- Phthalide, 3-(3-furyl)-3a,4,5,6-tetrahydro-3a,7-dimethyl-
- Fraxinellone
