CymitQuimica logo

CAS 288251-51-4

:

1-(1,1-Dimethylethyl)-5-methyl-1H-pyrazole-4-carboxylic acid

Description:
1-(1,1-Dimethylethyl)-5-methyl-1H-pyrazole-4-carboxylic acid, with the CAS number 288251-51-4, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a tert-butyl group (1,1-dimethylethyl) and a methyl group attached to the pyrazole ring, contributing to its unique steric and electronic properties. The presence of a carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit acidic behavior. This compound is often studied for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity and ability to interact with specific biological targets. Its solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, the structural features of this compound suggest it may have interesting chemical behavior and potential utility in synthetic chemistry and medicinal applications.
Formula:C9H14N2O2
InChI:InChI=1S/C9H14N2O2/c1-6-7(8(12)13)5-10-11(6)9(2,3)4/h5H,1-4H3,(H,12,13)
InChI key:InChIKey=OTFVOPYELVXHGT-UHFFFAOYSA-N
SMILES:CC=1N(C(C)(C)C)N=CC1C(O)=O
Synonyms:
  • 1-tert-Butyl-5-methyl-1H-pyrazole-4-carboxylic acid
  • 1-(1,1-Dimethylethyl)-5-methyl-1H-pyrazole-4-carboxylic acid
  • 1H-Pyrazole-4-carboxylic acid, 1-(1,1-dimethylethyl)-5-methyl-
Found 4 products.