CymitQuimica logo

CAS 288627-94-1

:

1H-Imidazolium, 1-hexyl-2,3-dimethyl-, iodide

Description:
1H-Imidazolium, 1-hexyl-2,3-dimethyl-, iodide, with the CAS number 288627-94-1, is an ionic liquid characterized by its imidazolium cation and iodide anion. This compound features a hexyl alkyl chain and two methyl groups on the imidazole ring, contributing to its unique properties. As an ionic liquid, it typically exhibits low volatility, high thermal stability, and good solvation capabilities, making it suitable for various applications, including catalysis, electrochemistry, and as a solvent for organic reactions. The presence of the hexyl group enhances its hydrophobicity, while the methyl groups can influence its viscosity and melting point. Additionally, the iodide anion can impart specific reactivity and solubility characteristics. Overall, this compound is of interest in both academic and industrial research due to its potential in green chemistry and sustainable processes.
Formula:C11H21N2I
InChI:InChI=1S/C11H21N2.HI/c1-4-5-6-7-8-13-10-9-12(3)11(13)2;/h9-10H,4-8H2,1-3H3;1H/q+1;/p-1
InChI key:YYXZQUOJBJOARI-UHFFFAOYSA-M
SMILES:CCCCCCN1C=C[N+](=C1C)C.[I-]
Synonyms:
  • 1-Hexyl-2,3-dimethylimidazolium Iodide
  • 1-Hexyl-2,3-dimethylimidazolium Iodide
Found 4 products.