CAS 28924-21-2
:1-[3,5-Bis(phenylmethoxy)phenyl]ethanone
Description:
1-[3,5-Bis(phenylmethoxy)phenyl]ethanone, with the CAS number 28924-21-2, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This substance features a central ethanone moiety attached to a phenyl ring that is further substituted with two phenylmethoxy groups at the 3 and 5 positions. The presence of multiple aromatic rings contributes to its potential stability and hydrophobicity, which may influence its solubility in organic solvents. The compound's structure suggests it may exhibit interesting electronic properties and could participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, due to the electron-rich nature of the aromatic rings. Additionally, the presence of methoxy groups can enhance its reactivity and solubility characteristics. Such compounds are often studied for their potential applications in organic synthesis, materials science, and pharmaceuticals, where their unique structural features can lead to diverse functionalities.
Formula:C22H20O3
InChI:InChI=1S/C22H20O3/c1-17(23)20-12-21(24-15-18-8-4-2-5-9-18)14-22(13-20)25-16-19-10-6-3-7-11-19/h2-14H,15-16H2,1H3
InChI key:InChIKey=KOJXGMJOTRYLBD-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=CC(OCC3=CC=CC=C3)=CC(C(C)=O)=C2
Synonyms:- 1-[3,5-Bis(Benzyloxy)Phenyl]Ethanone
- 1-[3,5-Bis(phenylmethoxy)phenyl]ethanone
- 3',5'-Dibenzyloxyacetophenone
- 3,5-Bis(Benzyloxy)Acetophenone
- Acetophenone, 3′,5′-bis(benzyloxy)-
- Ethanone, 1-[3,5-bis(phenylmethoxy)phenyl]-
- 3′,5′-Dibenzyloxyacetophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3',5'-Dibenzyloxyacetophenone
CAS:Formula:C22H20O3Purity:>97.0%(GC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:332.40Ethanone, 1-[3,5-bis(phenylmethoxy)phenyl]-
CAS:Formula:C22H20O3Purity:98%Color and Shape:SolidMolecular weight:332.39241-[3,5-Bis(benzyloxy)phenyl]ethan-1-one
CAS:1-[3,5-Bis(benzyloxy)phenyl]ethan-1-oneFormula:C22H20O3Purity:97%Color and Shape:white to beige Solid-PowderMolecular weight:332.392393',5'-Dibenzyloxyacetophenone
CAS:3',5'-Dibenzyloxyacetophenone is a synthetic intermediate that can be used in the synthesis of 3-hydroxy-2-phenylpropionic acid. It can also be used to synthesize carbonyl reduction products, such as 3,5-dibenzyloxybenzoic acid and 2,3-dibenzyloxybenzoic acid. The carbonyl reduction reaction mechanism involves the addition of ethylene to the carbonyl group (C=O) and hydrogenation of the double bond between carbon atoms 1 and 2. This process may result in a mixture of products that are degradable or non-degradable and contain impurities.
Formula:C22H20O3Purity:Min. 95%Color and Shape:Beige PowderMolecular weight:332.39 g/mol3’,5’-Dibenzyloxyacetophenone
CAS:Controlled ProductFormula:C22H20O3Color and Shape:NeatMolecular weight:332.39







