CymitQuimica logo

CAS 2902-65-0

:

2-iodobenzene-1,3-dicarboxylic acid

Description:
2-Iodobenzene-1,3-dicarboxylic acid, with the CAS number 2902-65-0, is an aromatic compound characterized by the presence of a benzene ring substituted with two carboxylic acid groups (-COOH) and one iodine atom. This compound typically exhibits a crystalline solid form and is soluble in polar solvents due to the presence of the carboxylic acid groups, which can engage in hydrogen bonding. The iodine substituent can influence the compound's reactivity and physical properties, such as its melting point and boiling point. The presence of the carboxylic acid groups makes it acidic, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, 2-iodobenzene-1,3-dicarboxylic acid can serve as a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its unique structure also allows for potential applications in materials science and dye chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H5IO4
InChI:InChI=1/C8H5IO4/c9-6-4(7(10)11)2-1-3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:PBIDRTDEJPAXHY-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1)C(=O)O)I)C(=O)O
Found 5 products.