CymitQuimica logo

CAS 290315-45-6

:

BMS-299897

Description:
BMS-299897, with the CAS number 290315-45-6, is a chemical compound that has been studied primarily for its potential therapeutic applications, particularly in the field of neuroscience. It is known to act as a selective antagonist of the dopamine D3 receptor, which is implicated in various neuropsychiatric disorders. The compound's structure features a distinct arrangement of functional groups that contribute to its biological activity and receptor selectivity. BMS-299897 has been evaluated in preclinical studies for its effects on behaviors related to addiction and mood disorders, showcasing its potential as a candidate for drug development. Additionally, its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion, are crucial for understanding its efficacy and safety profile. Overall, BMS-299897 represents a significant interest in medicinal chemistry, particularly in the context of developing new treatments for conditions associated with dopamine dysregulation.
Formula:C24H21ClF3NO4S
InChI:InChI=1S/C24H21ClF3NO4S/c1-15(21-11-7-18(26)13-16(21)3-2-4-24(30)31)29(23-14-19(27)8-12-22(23)28)34(32,33)20-9-5-17(25)6-10-20/h5-15H,2-4H2,1H3,(H,30,31)/t15-/m1/s1
InChI key:IZAOBRWCUGOKNH-OAHLLOKOSA-N
SMILES:C[C@H](C1=C(C=C(C=C1)F)CCCC(=O)O)N(C2=C(C=CC(=C2)F)F)S(=O)(=O)C3=CC=C(C=C3)Cl
Found 5 products.