CAS 290815-26-8
:2-Pyridinesulfonamide,N-[6-methoxy-5-(2-methoxyphenoxy)-2-(4-pyridinyl)-4-pyrimidinyl]-5-methyl-
Description:
2-Pyridinesulfonamide, N-[6-methoxy-5-(2-methoxyphenoxy)-2-(4-pyridinyl)-4-pyrimidinyl]-5-methyl- is a chemical compound characterized by its complex structure, which includes a pyridine ring and a pyrimidine moiety. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although its specific biological activity would depend on the substituents and overall molecular configuration. The presence of methoxy groups suggests increased lipophilicity, which may enhance its ability to penetrate biological membranes. Additionally, the compound's structure indicates potential for interactions with various biological targets, making it of interest in medicinal chemistry. Its CAS number, 290815-26-8, allows for easy identification in chemical databases. As with many synthetic organic compounds, its solubility, stability, and reactivity would be influenced by the functional groups present, and it may undergo various chemical reactions typical of sulfonamides, such as sulfonation or nucleophilic substitution. Overall, this compound represents a class of molecules that could have significant implications in pharmaceutical research and development.
Formula:C23H21N5O5S
InChI:InChI=1S/C23H21N5O5S/c1-15-8-9-19(25-14-15)34(29,30)28-22-20(33-18-7-5-4-6-17(18)31-2)23(32-3)27-21(26-22)16-10-12-24-13-11-16/h4-14H,1-3H3,(H,26,27,28)
InChI key:YBWLTKFZAOSWSM-UHFFFAOYSA-N
SMILES:CC1=CN=C(C=C1)S(=O)(=O)NC2=C(C(=NC(=N2)C3=CC=NC=C3)OC)OC4=CC=CC=C4OC
Synonyms:- Avosentan
- Ro 67-0565
- Spp 301
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Pyridinesulfonamide, N-[6-methoxy-5-(2-methoxyphenoxy)-2-(4-pyridinyl)-4-pyrimidinyl]-5-methyl-
CAS:Formula:C23H21N5O5SPurity:98.4552%Molecular weight:479.5083Avosentan
CAS:Avosentan is an endothelin receptor antagonist that has been shown to be a long-term effective treatment for chronic kidney disease in diabetic patients. It blocks the binding of endothelin-A to its receptor, which prevents the constriction and dilation of blood vessels. Avosentan has been shown to increase renal function by inhibiting tubulointerstitial injury and reducing the rate of progression of chronic kidney disease. This drug also has a positive effect on congestive heart failure, as it increases cardiac output and reduces afterload. Avosentan also stimulates growth factor production in heart tissue, which may account for some of its positive effects on cardiac function.Formula:C23H21N5O5SPurity:Min. 95%Molecular weight:479.51 g/molAvosentan
CAS:Avosentan(Ro 67-0565; SPP-301) is a potent endothelin receptor (ETA) antagonist.Cost-effective and quality-assured.Formula:C23H21N5O5SPurity:98.31% - 99.86%Color and Shape:SolidMolecular weight:479.51






