CymitQuimica logo

CAS 290832-43-8

:

[2-methoxy-5-(trifluoromethoxy)phenyl]boronic acid

Description:
[2-Methoxy-5-(trifluoromethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various organic synthesis applications, particularly in Suzuki coupling reactions. This compound features a phenyl ring substituted with both a methoxy group and a trifluoromethoxy group, which can influence its electronic properties and reactivity. The trifluoromethoxy group is notable for its strong electron-withdrawing effect, which can enhance the acidity of the boronic acid moiety. The presence of the methoxy group can also affect solubility and sterics. In terms of physical properties, boronic acids typically exhibit moderate solubility in polar solvents, and their reactivity can be influenced by pH and the presence of other functional groups. This compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block in organic synthesis.
Formula:C8H8BF3O4
InChI:InChI=1/C8H8BF3O4/c1-15-7-3-2-5(16-8(10,11)12)4-6(7)9(13)14/h2-4,13-14H,1H3
InChI key:PZDNMFGRXYPDJA-UHFFFAOYSA-N
SMILES:COc1ccc(cc1B(O)O)OC(F)(F)F
Synonyms:
  • boronic acid, B-[2-methoxy-5-(trifluoromethoxy)phenyl]-
  • 2-Isopropoxy-5-(Trifluoromethoxy)Phenylboronicacid
  • 2-Methoxy-5-(Trifluoromethoxy)Phenylboronic Acid
  • 2-Methoxy-5-(Trifluoromethoxy)Phenylboronicacid
  • [2-Methoxy-5-(trifluoromethoxy)phenyl]boronic acid
Found 5 products.