CymitQuimica logo

CAS 291289-50-4

:

4-(2,4-Difluorophenyl)piperidine

Description:
4-(2,4-Difluorophenyl)piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 2,4-difluorophenyl group attached to the piperidine ring significantly influences its chemical properties and biological activity. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, reflecting its hydrophobic character due to the aromatic fluorinated substituents. The difluorophenyl moiety can enhance the compound's lipophilicity and may contribute to its potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the fluorine atoms can impart unique electronic properties, affecting the compound's reactivity and stability. Safety data and handling precautions should be considered, as with any chemical substance, particularly regarding its potential toxicity and environmental impact. Overall, 4-(2,4-Difluorophenyl)piperidine is a compound of interest for research and development in various chemical and pharmaceutical applications.
Formula:C11H13F2N
InChI:InChI=1/C11H13F2N/c12-9-1-2-10(11(13)7-9)8-3-5-14-6-4-8/h1-2,7-8,14H,3-6H2
InChI key:KUYHSQRDRQUVOK-UHFFFAOYSA-N
SMILES:c1cc(C2CCNCC2)c(cc1F)F
Synonyms:
  • 4-(2,4-Difluorphenyl)piperidin
  • Piperidine, 4-(2,4-difluorophenyl)-
  • 4-(2,4-Difluoro-Phenyl)-Piperidine
Found 4 products.