CAS 29182-42-1
:ethyl 1,3-benzothiazol-2-ylacetate
Description:
Ethyl 1,3-benzothiazol-2-ylacetate is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound typically appears as a pale yellow to light brown liquid or solid, depending on its purity and form. It is known for its potential applications in various fields, including pharmaceuticals, agrochemicals, and as a chemical intermediate. Ethyl 1,3-benzothiazol-2-ylacetate exhibits moderate solubility in organic solvents, while its solubility in water is generally low, which is common for many aromatic compounds. The presence of the ethyl ester group contributes to its reactivity, making it a useful building block in organic synthesis. Additionally, this compound may exhibit biological activity, including antimicrobial or antifungal properties, although specific biological effects can vary based on concentration and environmental conditions. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or environmental impact.
Formula:C11H11NO2S
InChI:InChI=1/C11H11NO2S/c1-2-14-11(13)7-10-12-8-5-3-4-6-9(8)15-10/h3-6H,2,7H2,1H3
SMILES:CCOC(=O)Cc1nc2ccccc2s1
Synonyms:- 2-Benzothiazoleacetic Acid Ethyl Ester
- 1,3-Benzothiazol-2-Ylacetic Acid Ethyl Ester
- Ethyl 2-Benzothiazoleacetate
- 2-(2-Benzothiazolyl)acetic Acid Ethyl Ester
- Ethyl 2-Benzothiazol-2-Ylacetate
- Ethyl 2-(benzo[d]thiazol-2-yl)acetate
- Benzothiazol-2-yl-acetic acid ethyl ester
- Ethyl 2-(1,3-Benzothiazol-2-Yl)Acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 2-(2-Benzothiazolyl)acetate
CAS:Formula:C11H11NO2SPurity:>95.0%(HPLC)Color and Shape:Light yellow to Yellow to Orange clear liquidMolecular weight:221.27Ethyl-2-(2-benzothiazolyl) acetate
CAS:Ethyl-2-(2-benzothiazolyl) acetateFormula:C11H11NO2SPurity:98%Color and Shape:Liquid-ClearMolecular weight:221.2792-Benzothiazoleacetic acid, ethyl ester
CAS:Formula:C11H11NO2SPurity:95%Color and Shape:SolidMolecular weight:221.2755Benzothiazol-2-yl-acetic acid ethyl ester
CAS:Formula:C11H11NO2SPurity:95%Color and Shape:Liquid, ClearMolecular weight:221.27Ethyl 1,3-benzothiazol-2-ylacetate
CAS:Ethyl 1,3-benzothiazol-2-ylacetate is a coumarin derivative that has been shown to be active against tuberculosis. It inhibits bacterial growth by binding to the gyrase enzyme and preventing the formation of a new DNA strand. The synthesis of ethyl 1,3-benzothiazol-2-ylacetate starts with the condensation of 2 molecules of acetoacetic ester in the presence of an acid catalyst. This reaction takes place in vivo in animal tissues and is catalyzed by enzymes such as gyrase or topoisomerase IV. The reaction time for this synthesis is typically 3 hours. Ethyl 1,3-benzothiazol-2-ylacetate emits fluorescent emissions at a wavelength of 330 nanometers.Formula:C11H11NO2SPurity:Min. 95%Molecular weight:221.28 g/mol




