CymitQuimica logo

CAS 29212-22-4

:

2-Thiophenecarboxylic acid, 5-methoxy-

Description:
2-Thiophenecarboxylic acid, 5-methoxy- is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylic acid functional group (-COOH) at the second position and a methoxy group (-OCH3) at the fifth position of the thiophene ring. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The methoxy group can influence the compound's solubility and polarity, while the carboxylic acid group can participate in acid-base reactions and form esters or amides. Additionally, the thiophene ring can engage in π-π stacking interactions and contribute to the compound's electronic properties. Overall, 2-Thiophenecarboxylic acid, 5-methoxy- exhibits unique characteristics that make it of interest for further research and development in synthetic chemistry and material science.
Formula:C6H6O3S
InChI:InChI=1S/C6H6O3S/c1-9-5-3-2-4(10-5)6(7)8/h2-3H,1H3,(H,7,8)
InChI key:ILLPXKQRQUSURG-UHFFFAOYSA-N
SMILES:COC1=CC=C(S1)C(=O)O
Found 5 products.