CymitQuimica logo

CAS 29241-62-1

:

5-Bromo-6-chloronicotinic acid

Description:
5-Bromo-6-chloronicotinic acid is a heterocyclic organic compound that belongs to the class of substituted pyridine carboxylic acids. It features a pyridine ring with two halogen substituents: a bromine atom at the 5-position and a chlorine atom at the 6-position, along with a carboxylic acid functional group (-COOH) at the 3-position. This compound is typically characterized by its solid state at room temperature, and it is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The presence of halogens can influence its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be of interest in medicinal chemistry. Its molecular structure contributes to its unique properties, making it a subject of study in organic synthesis and material science. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H2BrClNO2
InChI:InChI=1/C6H3BrClNO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11)/p-1
InChI key:DXEUARPQHJXMII-UHFFFAOYSA-N
SMILES:c1c(cnc(c1Br)Cl)C(=O)[O-]
Synonyms:
  • 3-Pyridinecarboxylic acid, 5-bromo-6-chloro-
  • 5-Bromo-6-Chloropyridine-3-Carboxylic Acid
  • 5-Bromo-6-Chloropyridine-3-Carboxylate
Found 6 products.