CAS 29270-56-2
:4-Fluoro-7-nitrobenzofurazan
Description:
4-Fluoro-7-nitrobenzofurazan, with the CAS number 29270-56-2, is a synthetic organic compound characterized by its distinctive benzofurazan structure, which features a nitro group and a fluorine atom. This compound typically exhibits a bright yellow color and is known for its high stability and solubility in organic solvents. It is often utilized in various applications, including as a fluorescent probe in biochemical assays due to its ability to undergo specific chemical reactions that yield fluorescent products. The presence of the nitro group contributes to its electron-withdrawing properties, enhancing its reactivity in nucleophilic substitution reactions. Additionally, the fluorine atom can influence the compound's electronic properties and lipophilicity, making it useful in medicinal chemistry and material science. Safety considerations should be taken into account when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate protective measures should be employed in laboratory settings.
Formula:C6H2FN3O3
InChI:InChI=1/C6H2FN3O3/c7-3-1-2-4(10(11)12)6-5(3)8-13-9-6/h1-2H
SMILES:c1cc(c2c(c1F)non2)N(=O)=O
Synonyms:- 4-Fluoro-7-Nitrobenzo[C][1,2,5]Oxadiazole
- Nbd-F
- 4-Fluoro-7-Nitrobenzo[C][1,2,5]Oxadioxle
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
NBD-F (=4-Fluoro-7-nitro-2,1,3-benzoxadiazole) [for HPLC Labeling]
CAS:Formula:C6H2FN3O3Purity:>99.0%(HPLC)Color and Shape:White to Yellow to Green powder to crystalMolecular weight:183.104-Fluoro-7-nitrobenzofurazan
CAS:Useful for amino acid and amine fluorescent labeling in HPLCFormula:C6H2FN3O3Color and Shape:White to yellow or green, Crystals or powder or crystalline powderMolecular weight:183.102,1,3-Benzoxadiazole, 4-fluoro-7-nitro-
CAS:Formula:C6H2FN3O3Purity:97%Color and Shape:SolidMolecular weight:183.09684-Fluoro-7-nitro-2,1,3-benzoxadiazole
CAS:4-Fluoro-7-nitro-2,1,3-benzoxadiazoleFormula:C6H2FN3O3Purity:99%Color and Shape:Solid-PowderMolecular weight:183.09678NBD-F
CAS:NBD-F (4-Fluoro-7-nitrobenzofurazan) is a fluorescent derivatization compound for amino acid analysis.Formula:C6H2FN3O3Purity:99.05% - 99.51%Color and Shape:SolidMolecular weight:183.14-Fluoro-7-nitro-2,1,3-benzoxadiazole
CAS:Controlled ProductApplications A fluorescence reagent used to evaluate amino acid racemates from homogenized retinal tissue.
References Imai, K., et al.: Biomed. Chromatogr., 10, 303 (1996), Tsai, G., et al.: Biol. Psychiatry, 44, 1081 (1998), Ribeiro, C., et al.: Brain Res. 929, 202 (2002),Formula:C6H2FN3O3Color and Shape:NeatMolecular weight:183.14-Fluoro-7-nitro-[2,1,3]-benzoxadiazole
CAS:Formula:C6H2FN3O3Purity:97%Color and Shape:SolidMolecular weight:183.098Ref: 10-F008587
5mg53.00€10mg79.00€25mg104.00€50mg107.00€100mg171.00€250mg251.00€1g563.00€5g1,788.00€







