CymitQuimica logo

CAS 29270-56-2

:

4-Fluoro-7-nitrobenzofurazan

Description:
4-Fluoro-7-nitrobenzofurazan, with the CAS number 29270-56-2, is a synthetic organic compound characterized by its distinctive benzofurazan structure, which features a nitro group and a fluorine atom. This compound typically exhibits a bright yellow color and is known for its high stability and solubility in organic solvents. It is often utilized in various applications, including as a fluorescent probe in biochemical assays due to its ability to undergo specific chemical reactions that yield fluorescent products. The presence of the nitro group contributes to its electron-withdrawing properties, enhancing its reactivity in nucleophilic substitution reactions. Additionally, the fluorine atom can influence the compound's electronic properties and lipophilicity, making it useful in medicinal chemistry and material science. Safety considerations should be taken into account when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate protective measures should be employed in laboratory settings.
Formula:C6H2FN3O3
InChI:InChI=1/C6H2FN3O3/c7-3-1-2-4(10(11)12)6-5(3)8-13-9-6/h1-2H
InChI key:PGZIDERTDJHJFY-UHFFFAOYSA-N
SMILES:c1cc(c2c(c1F)non2)N(=O)=O
Synonyms:
  • 4-Fluoro-7-Nitrobenzo[C][1,2,5]Oxadiazole
  • Nbd-F
  • 4-Fluoro-7-Nitrobenzo[C][1,2,5]Oxadioxle
Found 10 products.