CymitQuimica logo

CAS 29278-09-9

:

ethyl 5-amino-3-phenyl-1,2-oxazole-4-carboxylate

Description:
Ethyl 5-amino-3-phenyl-1,2-oxazole-4-carboxylate is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing nitrogen and oxygen. This substance features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of an amino group at the 5-position and a phenyl group at the 3-position of the oxazole ring enhances its potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. The carboxylate moiety at the 4-position provides acidic properties, making it a potential candidate for further derivatization. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be considered when working with this compound in a laboratory setting.
Formula:C12H12N2O3
InChI:InChI=1/C12H12N2O3/c1-2-16-12(15)9-10(14-17-11(9)13)8-6-4-3-5-7-8/h3-7H,2,13H2,1H3
InChI key:RXAUWXZMIWBIES-UHFFFAOYSA-N
SMILES:CCOC(=O)c1c(c2ccccc2)noc1N
Found 4 products.