CAS 2928606-69-1

Pim-1 kinase inhibitor 6

Description:

Pim-1 kinase inhibitor 6, identified by its CAS number 2928606-69-1, is a small molecule that serves as an inhibitor of the Pim-1 kinase, an enzyme involved in various cellular processes, including cell survival and proliferation. This compound is part of a class of inhibitors that target serine/threonine kinases, which play crucial roles in cancer biology and other diseases. The characteristics of Pim-1 kinase inhibitor 6 include its potential to modulate signaling pathways associated with tumor growth and survival, making it a candidate for therapeutic applications in oncology. The compound typically exhibits a specific binding affinity for the Pim-1 kinase, which can be assessed through various biochemical assays. Additionally, it may possess favorable pharmacokinetic properties, such as solubility and stability, which are essential for its efficacy as a drug. Research into this inhibitor is ongoing, focusing on its mechanism of action, potential side effects, and overall therapeutic profile in the context of cancer treatment.

Formula: C21H10BrCl2N3

InChI: InChI=1S/C21H10BrCl2N3/c22-14-7-5-12(6-8-14)19-10-15(17(11-25)21(24)27-19)16-9-13-3-1-2-4-18(13)26-20(16)23/h1-10H

InChI key: PJVIWFUJHRPIGU-UHFFFAOYSA-N

SMILES: C1=CC=C2C(=C1)C=C(C(=N2)Cl)C3=CC(=NC(=C3C#N)Cl)C4=CC=C(C=C4)Br

Synonyms:

• Pim-1 kinase inhibitor 6

Pim-1 kinase inhibitor 6

CAS: 2928606-69-1

Pim-1 kinase inhibitor 6 (Compound 4d) is a robust inhibitor of Pim-1 kinase, demonstrating an IC 50 of 0.46 μM. It significantly exhibits cytotoxic effects on cancer cells [1].

Formula: C₂₁H₁₀BrCl₂N₃

Color and Shape: Solid

Molecular weight: 455.13

Ref: TM-T87213