CAS 29310-88-1
:3-(Bromoacetyl)coumarin
Description:
3-(Bromoacetyl)coumarin is a chemical compound that belongs to the class of coumarins, which are known for their aromatic properties and diverse biological activities. This compound features a coumarin backbone substituted with a bromoacetyl group at the 3-position, which enhances its reactivity and potential for further chemical modifications. It typically appears as a crystalline solid and is characterized by its distinct absorption in the ultraviolet-visible spectrum due to the presence of the coumarin moiety. The bromoacetyl group introduces electrophilic characteristics, making it useful in various synthetic applications, including the development of pharmaceuticals and agrochemicals. Additionally, compounds like 3-(Bromoacetyl)coumarin are often studied for their potential biological activities, including antimicrobial and anticancer properties. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, 3-(Bromoacetyl)coumarin is a versatile compound with significant implications in organic synthesis and medicinal chemistry.
Formula:C11H7BrO3
InChI:InChI=1/C11H7BrO3/c12-6-9(13)8-5-7-3-1-2-4-10(7)15-11(8)14/h1-5H,6H2
SMILES:c1ccc2c(c1)cc(C(=O)CBr)c(=O)o2
Synonyms:- 3-(2-Bromoacetyl)-2H-chromen-2-one
- 3-(bromoacetyl)-2H-chromen-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-ω-Bromoacetylcoumarin
CAS:3-ω-BromoacetylcoumarinFormula:C11H7BrO3Purity:>98%Color and Shape:SolidMolecular weight:267.075482H-1-BENZOPYRAN-2-ONE, 3-(2-BROMOACETYL)-
CAS:Formula:C11H7BrO3Purity:98%Color and Shape:SolidMolecular weight:267.07553-(Bromoacetyl)coumarin
CAS:Formula:C11H7BrO3Purity:>95.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:267.083-ω-Bromoacetylcoumarin
CAS:3-(2-Bromoacetyl)-2H-chromen-2-oneFormula:C11H7BrO3Purity:98%Molecular weight:267.083-(bromoacetyl)-2H-chromen-2-one
CAS:Formula:C11H7BrO3Purity:≥95%(HPLC)Color and Shape:SolidMolecular weight:267.0783-(2-Bromoacetyl)-2H-chromen-2-one
CAS:3-(2-Bromoacetyl)-2H-chromen-2-one is a compound that has been shown to inhibit the growth of human liver cancer cells and has been used in the treatment of some cancers. 3-(2-Bromoacetyl)-2H-chromen-2-one is a nucleophile, which reacts with electrophiles, such as 2Nal, to form an intermediate covalent bond. The reaction mechanism for this process involves a nucleophilic substitution reaction, where one atom (the nucleophile) attacks another atom (the electrophile) from the side opposite its electron cloud. This process results in the formation of a covalent bond between the two atoms and the release of water. 3-(2-Bromoacetyl)-2H-chromen-2one was found to be effective against Streptococcus faecalis and other bacteria after being tested in vitro with these organisms. In addition to beingFormula:C11H7BrO3Purity:Min. 95%Color and Shape:PowderMolecular weight:267.08 g/mol





