CymitQuimica logo

CAS 2933173-97-6

:

Amino-PEG16-alcohol

Description:
Amino-PEG16-alcohol, identified by its CAS number 2933173-97-6, is a polyethylene glycol (PEG) derivative that features an amino group and a terminal alcohol group. This compound typically exhibits characteristics common to PEGs, such as good solubility in water and organic solvents, biocompatibility, and low toxicity, making it suitable for various applications in biochemistry and pharmaceuticals. The presence of the amino group allows for potential reactivity, enabling conjugation with other molecules, which is valuable in drug delivery systems and the development of biomaterials. The PEG chain length, in this case, consisting of 16 ethylene glycol units, contributes to its hydrophilicity and can influence the physical properties, such as viscosity and melting point. Additionally, the terminal alcohol group can participate in further chemical modifications, enhancing its versatility in synthetic applications. Overall, Amino-PEG16-alcohol is a multifunctional compound that plays a significant role in enhancing the solubility and stability of therapeutic agents.
Formula:C32H67NO16
InChI:InChI=1S/C32H67NO16/c33-1-3-35-5-7-37-9-11-39-13-15-41-17-19-43-21-23-45-25-27-47-29-31-49-32-30-48-28-26-46-24-22-44-20-18-42-16-14-40-12-10-38-8-6-36-4-2-34/h34H,1-33H2
InChI key:ASCIIOSYDHUDER-UHFFFAOYSA-N
SMILES:C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)N
Synonyms:
  • NH2-PEG16-OH
  • Amino-PEG16-alcohol
Found 2 products.