CymitQuimica logo

CAS 29335-36-2

:

Propionamidoxime

Description:
Propionamidoxime, with the CAS number 29335-36-2, is an organic compound characterized by its amide and oxime functional groups. It typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and as an intermediate in the production of various chemicals. The compound features a propionamide backbone, which contributes to its reactivity and solubility properties. Propionamidoxime may exhibit moderate polarity due to the presence of both the amide and oxime groups, influencing its interactions with other substances. Additionally, it may participate in various chemical reactions, such as condensation and substitution, making it valuable in synthetic chemistry. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe usage and compliance with regulatory standards. Overall, propionamidoxime is a noteworthy compound in the realm of organic chemistry, with specific characteristics that facilitate its use in various chemical processes.
Formula:C3H8N2O
InChI:InChI=1/C3H8N2O/c1-2-3(4)5-6/h6H,2H2,1H3,(H2,4,5)
InChI key:RLZPCFQNZGINRP-UHFFFAOYSA-N
SMILES:CCC(=N)NO
Synonyms:
  • N-Hydroxypropanimidamide
  • Propanimidamide, N-hydroxy-
  • propanimidamide, N'-hydroxy-, (1Z)-
Found 6 products.