CymitQuimica logo

CAS 29376-68-9

:

4H-1-Benzopyran-4-one,7-hydroxy-2-(4-hydroxyphenyl)-5-methoxy-

Description:
4H-1-Benzopyran-4-one, 7-hydroxy-2-(4-hydroxyphenyl)-5-methoxy- is a chemical compound that belongs to the class of flavonoids, specifically a type of chromone. This compound features a benzopyran structure, which consists of a fused benzene and pyran ring, contributing to its aromatic properties. The presence of hydroxyl groups (-OH) at specific positions enhances its potential for hydrogen bonding and increases its solubility in polar solvents. The methoxy group (-OCH3) further influences its reactivity and stability. This compound is of interest in various fields, including medicinal chemistry, due to its potential antioxidant, anti-inflammatory, and anticancer properties. Its structural characteristics may also allow for interactions with biological targets, making it a candidate for further pharmacological studies. Additionally, the compound's unique functional groups can affect its spectral properties, making it suitable for analytical techniques such as UV-Vis spectroscopy and NMR. Overall, 4H-1-Benzopyran-4-one, 7-hydroxy-2-(4-hydroxyphenyl)-5-methoxy- exhibits a combination of chemical properties that may contribute to its biological activity.
Formula:C16H12O5
InChI:InChI=1S/C16H12O5/c1-20-14-6-11(18)7-15-16(14)12(19)8-13(21-15)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3
InChI key:YQABHAHJGSNVQR-UHFFFAOYSA-N
SMILES:COC1=CC(=CC2=C1C(=O)C=C(O2)C3=CC=C(C=C3)O)O
Synonyms:
  • Flavone,4',7-dihydroxy-5-methoxy- (8CI)
  • Apigenin 5-O-monomethyl ether
  • Apigenin-5-methyl ether
  • Thevetiaflavone
Found 6 products.