CAS 2941-55-1: Ethiolate

Description:Ethiolate, with the CAS number 2941-55-1, is a chemical compound that belongs to the class of organosulfur compounds. It is characterized by the presence of a sulfur atom bonded to an ethyl group, which contributes to its reactivity and properties. Ethiolate typically exists as a salt or an anion, often formed by the deprotonation of ethanethiol. This compound is known for its nucleophilic properties, making it a useful reagent in various organic synthesis reactions, particularly in the formation of carbon-sulfur bonds. Ethiolate can participate in substitution reactions and is often employed in the synthesis of thiol derivatives and other sulfur-containing compounds. Its stability and reactivity can be influenced by the surrounding conditions, such as solvent and temperature. As with many organosulfur compounds, safety precautions should be taken when handling ethiolate due to its potential toxicity and reactivity. Overall, ethiolate is a valuable compound in the field of organic chemistry, particularly in synthetic applications.

Formula:C₇H₁₅NOS

InChI:InChI=1S/C7H15NOS/c1-4-8(5-2)7(9)10-6-3/h4-6H2,1-3H3

InChI key:InChIKey=WARIWGPBHKPYON-UHFFFAOYSA-N

SMILES:O=C(SCC)N(CC)CC

Synonyms:
Carbamic acid, diethylthio-, S-ethyl ester
Carbamothioic acid, N,N-diethyl-, S-ethyl ester
Carbamothioic acid, diethyl-, S-ethyl ester
Etirox
S-Ethyl N,N-diethylthiocarbamate
S-ethyl diethylcarbamothioate
S-ethyl diethylthiocarbamate
Ethiolate

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Ethiolate REF: 04-C13260000CAS: 2941-55-1	- - -	79.00 €	Tue 29 Apr 25
GB 23200.113-2018 Group B 105 Pesticides 10 ug/ml in Ethyl acetate REF: 04-A50000093EACAS: 101-21-3 101007-06-1 1014-69-3 102851-06-9 1113-02-6 112281-77-3 113614-08-7 114369-43-6 117-18-0 119-12-0 119446-68-3 120068-37-3 121-75-5 121552-61-2 122-14-5 122-34-9 122-39-4 131341-86-1 13171-21-6 136426-54-5 141-66-2 15299-99-7 153233-91-1 15457-05-3 1563-66-2 1610-17-9 1634-78-2 1746-81-2 1836-75-5 1861-40-1 1912-24-9 21609-90-5 2310-17-0 23184-66-9 23505-41-1 23950-58-5 24353-61-5 2593-15-9 26225-79-6 2642-71-9 2675-77-6 2921-88-2 2941-55-1 297-97-2 298-00-0 299-84-3 300-76-5 309-00-2 31120-85-1 327-98-0 32809-16-8 333-41-5 34643-46-4 36335-67-8 36734-19-7 3766-81-2 38260-54-7 39515-41-8 40487-42-1 40596-69-8 41198-08-7 4147-51-7 42509-80-8 42576-02-3 470-90-6 4824-78-6 50512-35-1 510-15-6 5103-74-2 51338-27-3 52-85-7 527-20-8 53112-28-0 5598-13-0 56-72-4 563-12-2 57018-04-9 5915-41-3 60-57-1 60207-90-1 68359-37-5 69806-50-4 70124-77-5 709-98-8 71626-11-4 72-43-5 7287-19-6 732-11-6 73250-68-7 76738-62-0 77732-09-3 79983-71-4 80-33-1 81777-89-1 82-68-8 834-12-8 83657-24-3 886-50-0 88671-89-0 91465-08-6 92-52-4 94361-06-5 947-02-4 950-37-8 961-11-5	- - -	To inquire	Tue 29 Apr 25
S-Ethyl Ester N,N-Diethyl-carbamothioic Acid REF: TR-E918060CAS: 2941-55-1	- - -	1,136.00 €	Tue 10 Jun 25
N,N-Diethyl(ethylsulfanyl)formamide REF: 3D-CAA94155CAS: 2941-55-1	Min. 95%	- - -	Discontinued product