CymitQuimica logo

CAS 29415-71-2

:

5-(diethylamino)-2-(hydrazinylcarbonyl)benzoic acid

Description:
5-(Diethylamino)-2-(hydrazinylcarbonyl)benzoic acid, with the CAS number 29415-71-2, is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a diethylamino group and a hydrazinylcarbonyl group. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The diethylamino group contributes basicity and can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The hydrazinylcarbonyl moiety may impart biological activity, making this compound of interest in medicinal chemistry and drug development. Its structure suggests potential applications in areas such as pharmaceuticals, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. Overall, the compound's unique functional groups and structural features make it a subject of interest for further research and application in various chemical contexts.
Formula:C12H17N3O3
InChI:InChI=1/C12H17N3O3/c1-3-15(4-2)8-5-6-9(11(16)14-13)10(7-8)12(17)18/h5-7H,3-4,13H2,1-2H3,(H,14,16)(H,17,18)
InChI key:WNYLSNZNCJLARI-UHFFFAOYSA-N
SMILES:CCN(CC)c1ccc(c(c1)C(=O)O)C(=NN)O
Synonyms:
  • 1,2-Benzenedicarboxylic Acid, 4-(Diethylamino)-, 1-Hydrazide
Found 4 products.