CAS 2942-14-5

Benzothiazole, 5-methoxy-

Description:

Benzothiazole, 5-methoxy- is an organic compound characterized by its benzothiazole core, which consists of a benzene ring fused to a thiazole ring. This compound features a methoxy group (-OCH3) at the 5-position of the benzothiazole structure, which can influence its chemical reactivity and solubility. Benzothiazoles are known for their diverse applications, including use in pharmaceuticals, agrochemicals, and as fluorescent dyes. The presence of the methoxy group can enhance the compound's lipophilicity, potentially affecting its biological activity and interaction with various biological systems. Additionally, benzothiazole derivatives often exhibit interesting photophysical properties, making them valuable in materials science and organic electronics. The compound's CAS number, 2942-14-5, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status. As with many organic compounds, safety precautions should be observed when handling benzothiazole derivatives due to potential toxicity and environmental impact.

Formula: C₈H₇NOS

InChI: InChI=1S/C8H7NOS/c1-10-6-2-3-8-7(4-6)9-5-11-8/h2-5H,1H3

InChI key: PNJKZDLZKILFNF-UHFFFAOYSA-N

SMILES: COC1=CC2=C(C=C1)SC=N2

5-Methoxybenzo[d]thiazole

CAS: 2942-14-5

Formula: C₈H₇NOS

Purity: 98%

Color and Shape: Liquid

Molecular weight: 165.2123

Ref: IN-DA002YBW

5-Methoxybenzo[d]thiazole

CAS: 2942-14-5

5-Methoxybenzo[d]thiazole

Formula: C₈H₇NOS

Purity: 95%

Molecular weight: 165.21

Ref: IN-DG104540

5-Methoxy-1,3-benzothiazole

CAS: 2942-14-5

5-Methoxy-1,3-benzothiazole

Formula: C₈H₇NOS

Purity: 95%

Color and Shape: Solid

Molecular weight: 165.21228

Ref: 54-OR55451

5-Methoxybenzo[d]thiazole

CAS: 2942-14-5

Formula: C₈H₇NOS

Purity: 98%

Molecular weight: 165.21

Ref: 10-F220350

5-Methoxy-1,3-benzothiazole

CAS: 2942-14-5

5-Methoxy-1,3-benzothiazole is a cyclic heterocycle that has an optical yield of 2.5%. It is soluble in nonpolar solvents and has a reactive nature. The compound can be used to create benzothiazoles, styryl dyes, and other heterocycles. 5-Methoxy-1,3-benzothiazole is also used as a reagent to make quinazolinones and nonionic surfactants. The compound's optical properties are affected by the methylene group, which can be substituted with other groups to alter the properties of the molecule.

Formula: C₈H₇NOS

Purity: Min. 95%

Molecular weight: 165.21 g/mol

Ref: 3D-CAA94214