CAS 29421-92-9
:4-Bromo-2-methylthiophene
Description:
4-Bromo-2-methylthiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the 4-position and a methylthio group at the 2-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its moderate solubility in organic solvents, such as dichloromethane and ether, while being less soluble in water due to its hydrophobic nature. The bromine substituent enhances its reactivity, making it useful in various chemical reactions, including electrophilic aromatic substitution and cross-coupling reactions. Additionally, 4-Bromo-2-methylthiophene can serve as a building block in the synthesis of more complex organic molecules, particularly in the fields of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C5H5BrS
InChI:InChI=1/C5H5BrS/c1-4-2-5(6)3-7-4/h2-3H,1H3
SMILES:Cc1cc(cs1)Br
Synonyms:- Thiophene, 4-bromo-2-methyl-
- 2-Methyl-4-Bromothiophene
- 4-Bromo-2-methylthiophene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Bromo-2-methylthiophene
CAS:Formula:C5H5BrSPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:177.06Thiophene, 4-bromo-2-methyl-
CAS:Formula:C5H5BrSPurity:98%Color and Shape:LiquidMolecular weight:177.06224-Bromo-2-methylthiophene
CAS:4-Bromo-2-methylthiopheneFormula:C5H5BrSPurity:>98%Color and Shape:LiquidMolecular weight:177.06224-Bromo-2-methylthiophene
CAS:4-Bromo-2-methylthiopheneFormula:C5H5BrSPurity:98%Molecular weight:177.064-Bromo-2-methylthiophene
CAS:Formula:C5H5BrSPurity:95%Color and Shape:Liquid, ClearMolecular weight:177.064-Bromo-2-methylthiophene
CAS:4-Bromo-2-methylthiophene is a linker that is used in the synthesis of metal carbonyls. It has been shown to be an efficient cross-linking agent for the preparation of polymers. 4-Bromo-2-methylthiophene can be isomerized to 2,5-dimethylthiophene by heating it with hydroxylamine. 4-Bromo-2-methylthiophene can also catalyze the alkylation of nucleophiles such as ammonia and dimethyl sulfate, as well as nucleophilic attack on carboxylic acid derivatives. This compound is acidic, due to its chloride substituent, which can react with basic groups such as hydroxyl groups or amines.Formula:C5H5BrSPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:177.06 g/mol





