CymitQuimica logo

CAS 29421-92-9

:

4-Bromo-2-methylthiophene

Description:
4-Bromo-2-methylthiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the 4-position and a methylthio group at the 2-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its moderate solubility in organic solvents, such as dichloromethane and ether, while being less soluble in water due to its hydrophobic nature. The bromine substituent enhances its reactivity, making it useful in various chemical reactions, including electrophilic aromatic substitution and cross-coupling reactions. Additionally, 4-Bromo-2-methylthiophene can serve as a building block in the synthesis of more complex organic molecules, particularly in the fields of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C5H5BrS
InChI:InChI=1/C5H5BrS/c1-4-2-5(6)3-7-4/h2-3H,1H3
InChI key:ABMUSXPGSSMPLK-UHFFFAOYSA-N
SMILES:Cc1cc(cs1)Br
Synonyms:
  • Thiophene, 4-bromo-2-methyl-
  • 2-Methyl-4-Bromothiophene
  • 4-Bromo-2-methylthiophene
Found 5 products.