CAS 2946-20-5

2,5,6-Trimethylbenzoselenazole

Description:

2,5,6-Trimethylbenzoselenazole is an organic compound characterized by its unique structure, which includes a benzoselenazole ring system. This compound features a selenium atom incorporated into a five-membered heterocyclic ring, which is fused to a benzene ring. The presence of three methyl groups at the 2, 5, and 6 positions of the benzene ring contributes to its hydrophobic nature and can influence its reactivity and solubility in various solvents. The selenium atom in the structure can impart distinct electronic properties, making it of interest in various chemical applications, including organic synthesis and materials science. Additionally, compounds containing selenium are often studied for their potential biological activities, including antioxidant properties. The compound's molecular weight, melting point, and solubility characteristics are influenced by its specific structural features, which can be further explored through experimental data. Overall, 2,5,6-Trimethylbenzoselenazole represents a fascinating example of organoselenium chemistry with potential applications in diverse fields.

Formula: C₁₀H₁₁NSe

InChI: InChI=1S/C10H11NSe/c1-6-4-9-10(5-7(6)2)12-8(3)11-9/h4-5H,1-3H3

InChI key: InChIKey=LCZZKJPVZHCFMK-UHFFFAOYSA-N

SMILES: CC=1C=C2C(=CC1C)[Se]C(C)=N2

Synonyms:

• 2,5,6-Trimethyl-1,3-Benzoselenazole
• 2,5,6-Trimethylbenzo[d][1,3]selenazole
• Benzoselenazole, 2,5,6-trimethyl-
• 2,5,6-Trimethylbenzoselenazole

Benzoselenazole, 2,5,6-trimethyl-

CAS: 2946-20-5

Formula: C₁₀H₁₁NSe

Molecular weight: 224.161

Ref: IN-DA002YG3