CymitQuimica logo

CAS 294874-71-8

:

4,8-Dichlorobenzofuro[3,2-d]pyrimidine

Description:
4,8-Dichlorobenzofuro[3,2-d]pyrimidine is a heterocyclic compound characterized by its fused ring structure, which incorporates both benzofuro and pyrimidine moieties. This compound features two chlorine substituents at the 4 and 8 positions of the benzofuro framework, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of chlorine atoms can influence its electronic properties, making it a candidate for various applications in medicinal chemistry and material science. Additionally, the unique structural features of this compound may impart specific pharmacological properties, making it of interest in drug development. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, which can be exploited in synthetic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H4Cl2N2O
InChI:InChI=1S/C10H4Cl2N2O/c11-5-1-2-7-6(3-5)8-9(15-7)10(12)14-4-13-8/h1-4H
InChI key:InChIKey=FLULEERYFWMYDE-UHFFFAOYSA-N
SMILES:ClC1=C2C(C=3C(O2)=CC=C(Cl)C3)=NC=N1
Synonyms:
  • Benzofuro[3,2-d]pyrimidine, 4,8-dichloro-
  • 4,8-Dichlorobenzofuro[3,2-d]pyrimidine
Found 4 products.