CAS 29512-07-0
:Acetamide, N-cyclopropyl-
Description:
Acetamide, N-cyclopropyl- is an organic compound characterized by the presence of a cyclopropyl group attached to the nitrogen atom of the acetamide functional group. Its molecular structure includes a carbonyl group (C=O) and an amine (NH2) linked to an ethyl group, which contributes to its classification as an amide. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in polar solvents such as water and alcohols, which is a common trait for amides due to their ability to form hydrogen bonds. Acetamide, N-cyclopropyl- may exhibit interesting chemical reactivity, including potential participation in nucleophilic substitution reactions due to the presence of the nitrogen atom. Its applications can range from use in organic synthesis to potential roles in pharmaceuticals or agrochemicals, although specific applications may vary based on ongoing research and development. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H9NO
InChI:InChI=1S/C5H9NO/c1-4(7)6-5-2-3-5/h5H,2-3H2,1H3,(H,6,7)
InChI key:DUUADMGTZDJNRI-UHFFFAOYSA-N
SMILES:CC(=O)NC1CC1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery

