CymitQuimica logo

CAS 295344-96-6

:

(3R)-3-(4-methoxyphenyl)-3-{[(4-methylphenyl)sulfonyl]amino}propanoate

Description:
The chemical substance known as (3R)-3-(4-methoxyphenyl)-3-{[(4-methylphenyl)sulfonyl]amino}propanoate, with the CAS number 295344-96-6, is characterized by its complex molecular structure, which includes a propanoate backbone, a sulfonamide functional group, and aromatic rings. This compound features a chiral center at the propanoate position, indicating that it exists in a specific stereoisomeric form, which can influence its biological activity and interactions. The presence of the methoxy and methyl groups on the phenyl rings contributes to its lipophilicity, potentially affecting its solubility and permeability in biological systems. Additionally, the sulfonamide moiety is known for its role in medicinal chemistry, often enhancing the compound's pharmacological properties. Overall, this substance may exhibit interesting biological activities, making it a candidate for further research in drug development or therapeutic applications. However, specific properties such as melting point, solubility, and biological activity would require empirical data for comprehensive characterization.
Formula:C17H18NO5S
InChI:InChI=1/C17H19NO5S/c1-12-3-9-15(10-4-12)24(21,22)18-16(11-17(19)20)13-5-7-14(23-2)8-6-13/h3-10,16,18H,11H2,1-2H3,(H,19,20)/p-1/t16-/m1/s1
InChI key:PQGPQQVCVMNUQP-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)S(=O)(=O)NC(CC(=O)O)C2=CC=C(C=C2)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.