CAS 29550-13-8

5,6-Dihydroxy-7-methoxyflavone

Description:

5,6-Dihydroxy-7-methoxyflavone, with the CAS number 29550-13-8, is a flavonoid compound characterized by its polyphenolic structure, which includes multiple hydroxyl groups that contribute to its antioxidant properties. This compound typically exhibits a yellow to orange color, which is common among flavonoids, and is soluble in organic solvents. Its molecular structure features a flavone backbone with hydroxyl groups at the 5 and 6 positions and a methoxy group at the 7 position, influencing its biological activity and reactivity. 5,6-Dihydroxy-7-methoxyflavone is known for its potential health benefits, including anti-inflammatory, antimicrobial, and anticancer properties, making it of interest in pharmacological research. Additionally, its presence in various plants suggests a role in plant defense mechanisms and may contribute to the flavor and color of certain foods. As with many flavonoids, it may also interact with various biological pathways, highlighting its significance in both nutrition and medicinal chemistry.

Formula: C₁₆H₁₂O₅

InChI: InChI=1/C16H12O5/c1-20-13-8-12-14(16(19)15(13)18)10(17)7-11(21-12)9-5-3-2-4-6-9/h2-8,18-19H,1H3

SMILES: COc1cc2c(c(=O)cc(c3ccccc3)o2)c(c1O)O

Synonyms:

• Baicalein 7-methyl ether
• 5,6-dihydroxy-7-methoxy-2-phenyl-4H-chromen-4-one

Baicalein-7-methylether

CAS: 29550-13-8

Baicalein-7-methylether analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.

Formula: C₁₆H₁₂O₅

Purity: (HPLC) ≥90%

Color and Shape: Powder

Molecular weight: 284.28

Ref: 11-1250

4H-1-Benzopyran-4-one, 5,6-dihydroxy-7-methoxy-2-phenyl-

CAS: 29550-13-8

Formula: C₁₆H₁₂O₅

Purity: 99%

Color and Shape: Solid

Molecular weight: 284.2635

Ref: IN-DA002YQQ

7-O-Methylbaicalein

CAS: 29550-13-8

Formula: C₁₆H₁₂O₅

Molecular weight: 284.27

Ref: 7W-GY9885

Negletein

CAS: 29550-13-8

Negletein

Purity: ≥98%

Molecular weight: 284.26g/mol

Ref: 54-BUP08261

7-O-Methylbaicalein

CAS: 29550-13-8

Formula: C₁₆H₁₂O₅

Purity: 95%~99%

Molecular weight: 284.267

Ref: BP-BP3048

Negletein

CAS: 29550-13-8

1.

Formula: C₁₆H₁₂O₅

Purity: 98% - 99.86%

Color and Shape: Solid

Molecular weight: 284.26

Ref: TM-T2S0843

5,6-Dihydroxy-7-methoxyflavone

CAS: 29550-13-8

5,6-Dihydroxy-7-methoxyflavone is a naturally occurring flavonoid compound, which is predominantly sourced from various plants, often found in the leaves, stems, or roots. This compound belongs to the broader class of flavonoids, which are known for their diverse biochemical activities. As a flavone derivative, its structure includes hydroxyl and methoxy functional groups that contribute to its biological activity.

Formula: C₁₆H₁₂O₅

Purity: Min. 95%

Color and Shape: Yellow Powder

Molecular weight: 284.26 g/mol

Ref: 3D-FD65958