CAS 29550-13-8
:5,6-Dihydroxy-7-methoxyflavone
Description:
5,6-Dihydroxy-7-methoxyflavone, with the CAS number 29550-13-8, is a flavonoid compound characterized by its polyphenolic structure, which includes multiple hydroxyl groups that contribute to its antioxidant properties. This compound typically exhibits a yellow to orange color, which is common among flavonoids, and is soluble in organic solvents. Its molecular structure features a flavone backbone with hydroxyl groups at the 5 and 6 positions and a methoxy group at the 7 position, influencing its biological activity and reactivity. 5,6-Dihydroxy-7-methoxyflavone is known for its potential health benefits, including anti-inflammatory, antimicrobial, and anticancer properties, making it of interest in pharmacological research. Additionally, its presence in various plants suggests a role in plant defense mechanisms and may contribute to the flavor and color of certain foods. As with many flavonoids, it may also interact with various biological pathways, highlighting its significance in both nutrition and medicinal chemistry.
Formula:C16H12O5
InChI:InChI=1/C16H12O5/c1-20-13-8-12-14(16(19)15(13)18)10(17)7-11(21-12)9-5-3-2-4-6-9/h2-8,18-19H,1H3
SMILES:COc1cc2c(c(=O)cc(c3ccccc3)o2)c(c1O)O
Synonyms:- Baicalein 7-methyl ether
- 5,6-dihydroxy-7-methoxy-2-phenyl-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Baicalein-7-methylether
CAS:Baicalein-7-methylether analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C16H12O5Purity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:284.284H-1-Benzopyran-4-one, 5,6-dihydroxy-7-methoxy-2-phenyl-
CAS:Formula:C16H12O5Purity:99%Color and Shape:SolidMolecular weight:284.2635Ref: TM-T2S0843
1mg75.00€1mL*10mM (DMSO)161.00€5mg170.00€10mg281.00€25mg475.00€50mg677.00€100mg888.00€200mg1,243.00€5,6-Dihydroxy-7-methoxyflavone
CAS:5,6-Dihydroxy-7-methoxyflavone is a naturally occurring flavonoid compound, which is predominantly sourced from various plants, often found in the leaves, stems, or roots. This compound belongs to the broader class of flavonoids, which are known for their diverse biochemical activities. As a flavone derivative, its structure includes hydroxyl and methoxy functional groups that contribute to its biological activity.
Formula:C16H12O5Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:284.26 g/mol






