CAS 29578-39-0

3-bromo-5-fluoroanisole

Description:

3-Bromo-5-fluoroanisole, with the CAS number 29578-39-0, is an organic compound characterized by the presence of both bromine and fluorine substituents on an anisole structure. It features a methoxy group (-OCH3) attached to a benzene ring, which also bears a bromine atom at the 3-position and a fluorine atom at the 5-position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of the halogen substituents. The presence of both bromine and fluorine can influence the compound's physical properties, such as boiling point and solubility, as well as its chemical reactivity, making it a valuable intermediate in various chemical reactions. Additionally, its unique structure may impart specific biological activities, warranting further investigation in medicinal chemistry.

Formula: C₇H₆BrFO

InChI: InChI=1/C7H6BrFO/c1-10-7-3-5(8)2-6(9)4-7/h2-4H,1H3

SMILES: COc1cc(cc(c1)F)Br

Synonyms:

• 1-Bromo-3-Fluoro-5-Methoxybenzene
• 3-Fluoro-5-Bromoanisole

3-Bromo-5-fluoroanisole

CAS: 29578-39-0

Formula: C₇H₆BrFO

Purity: >98.0%(GC)

Color and Shape: Colorless to Light yellow clear liquid

Molecular weight: 205.03

Ref: 3B-B2945

Benzene, 1-bromo-3-fluoro-5-methoxy-

CAS: 29578-39-0

Formula: C₇H₆BrFO

Purity: 95%

Color and Shape: Solid

Molecular weight: 205.0243

Ref: IN-DA002YSJ

3-Bromo-5-fluoroanisole

CAS: 29578-39-0

3-Bromo-5-fluoroanisole

Formula: C₇H₆BrFO

Purity: 96%

Color and Shape: colorless solid

Molecular weight: 205.02g/mol

Ref: 54-PC1483

3-Bromo-5-fluoro-1-methoxybenzene

CAS: 29578-39-0

Formula: C₇H₆BrFO

Purity: 95%

Color and Shape: Clear

Molecular weight: 205.026

Ref: 10-F092994

3-Bromo-5-fluoroanisole

CAS: 29578-39-0

3-Bromo-5-fluoroanisole is a labile compound that can be stabilized by lithium. It undergoes aryllithium reactions with methoxy and alkoxy groups to form 3-bromo-5-methoxybenzene, 3-bromo-5-(2,3,4,5,6-pentafluorophenoxy)benzene, and 3-bromo-5-(2,3,4,5,6,-pentafluorophenyl)benzene. Lithium diisopropylamide reacts with the trimethylsilyl group of 3-bromo-5-(2,3,4,5,6,-pentafluorophenyl)benzene to produce 3-(2'-hydroxyethyl)-1H-[1']-[1']'-binaphthyl. The methoxy group of this product is then converted to an alk

Formula: C₇H₆BrFO

Purity: Min. 95%

Color and Shape: Colorless Clear Liquid

Molecular weight: 205.02 g/mol

Ref: 3D-FB33792