CAS 29578-39-0
:3-bromo-5-fluoroanisole
Description:
3-Bromo-5-fluoroanisole, with the CAS number 29578-39-0, is an organic compound characterized by the presence of both bromine and fluorine substituents on an anisole structure. It features a methoxy group (-OCH3) attached to a benzene ring, which also bears a bromine atom at the 3-position and a fluorine atom at the 5-position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of the halogen substituents. The presence of both bromine and fluorine can influence the compound's physical properties, such as boiling point and solubility, as well as its chemical reactivity, making it a valuable intermediate in various chemical reactions. Additionally, its unique structure may impart specific biological activities, warranting further investigation in medicinal chemistry.
Formula:C7H6BrFO
InChI:InChI=1/C7H6BrFO/c1-10-7-3-5(8)2-6(9)4-7/h2-4H,1H3
SMILES:COc1cc(cc(c1)F)Br
Synonyms:- 1-Bromo-3-Fluoro-5-Methoxybenzene
- 3-Fluoro-5-Bromoanisole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Bromo-5-fluoroanisole
CAS:Formula:C7H6BrFOPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:205.03Benzene, 1-bromo-3-fluoro-5-methoxy-
CAS:Formula:C7H6BrFOPurity:96%Color and Shape:SolidMolecular weight:205.02433-Bromo-5-fluoroanisole
CAS:3-Bromo-5-fluoroanisoleFormula:C7H6BrFOPurity:96%Color and Shape:Colourless to pale yellow. LiquidMolecular weight:205.024341-Bromo-3-fluoro-5-methoxybenzene
CAS:1-Bromo-3-fluoro-5-methoxybenzeneFormula:C7H6BrFOPurity:96%Molecular weight:205.023-Bromo-5-fluoro-1-methoxybenzene
CAS:Formula:C7H6BrFOPurity:95%Color and Shape:ClearMolecular weight:205.0263-Bromo-5-fluoroanisole
CAS:3-Bromo-5-fluoroanisole is a labile compound that can be stabilized by lithium. It undergoes aryllithium reactions with methoxy and alkoxy groups to form 3-bromo-5-methoxybenzene, 3-bromo-5-(2,3,4,5,6-pentafluorophenoxy)benzene, and 3-bromo-5-(2,3,4,5,6,-pentafluorophenyl)benzene. Lithium diisopropylamide reacts with the trimethylsilyl group of 3-bromo-5-(2,3,4,5,6,-pentafluorophenyl)benzene to produce 3-(2'-hydroxyethyl)-1H-[1']-[1']'-binaphthyl. The methoxy group of this product is then converted to an alkFormula:C7H6BrFOPurity:Min. 95%Color and Shape:Colorless Clear LiquidMolecular weight:205.02 g/mol





